Product correctly added to cart.

6-chloro-2-(1,4-diazepan-1-yl)-1,3-benzothiazole

CAS 348134-09-8: 6-chloro-2-(1,4-diazepan-1-yl)-1,3-benzothiazole

Description:6-Chloro-2-(1,4-diazepan-1-yl)-1,3-benzothiazole is a chemical compound characterized by its unique structure, which includes a benzothiazole moiety and a diazepane ring. The presence of a chlorine atom at the 6-position of the benzothiazole contributes to its reactivity and potential biological activity. This compound is typically classified as a heterocyclic organic compound due to the incorporation of nitrogen and sulfur atoms in its ring structures. It may exhibit various pharmacological properties, making it of interest in medicinal chemistry and drug development. The molecular structure suggests potential interactions with biological targets, which could lead to applications in treating various conditions. Additionally, the compound's solubility, stability, and reactivity can be influenced by the functional groups present, particularly the diazepane, which may affect its pharmacokinetics and pharmacodynamics. As with many synthetic compounds, safety and handling precautions are essential due to potential toxicity or reactivity.

Formula:C12H14ClN3S

InChI:InChI=1/C12H14ClN3S/c13-9-2-3-10-11(8-9)17-12(15-10)16-6-1-4-14-5-7-16/h2-3,8,14H,1,4-7H2

  • Synonyms:
  • 1-(6-Chlorobenzothiazol-2-yl)homopiperazine
There are currently no products for this CAS.
Welcome to CymitQuimica!We use cookies to enhance your visit. We do not include advertising.

Please see our Cookies Policy for more details or adjust your preferences in "Settings".