CAS 3482-38-0
:(4α,8α,9β,13α,14β,16β,17Z)-16-(Acetyloxy)-3,11-dioxo-29-nordammara-17(20),24-dien-21-oic acid
Description:
The chemical substance with the name "(4α,8α,9β,13α,14β,16β,17Z)-16-(Acetyloxy)-3,11-dioxo-29-nordammara-17(20),24-dien-21-oic acid" and CAS number "3482-38-0" is a complex organic compound characterized by its unique structural features, including multiple functional groups and a specific stereochemistry. It contains a dioxo moiety, indicating the presence of two carbonyl groups, which contribute to its reactivity and potential biological activity. The acetyloxy group suggests that it may participate in esterification reactions, while the presence of a long carbon chain indicates hydrophobic characteristics. The compound's stereochemistry, denoted by the specific alpha and beta configurations, plays a crucial role in determining its biological interactions and pharmacological properties. Such compounds are often studied for their potential therapeutic applications, particularly in the fields of medicinal chemistry and pharmacology. Overall, this substance exemplifies the complexity and diversity of organic molecules, with implications for both synthetic chemistry and biological research.
Formula:C31H44O6
InChI:InChI=1S/C31H44O6/c1-17(2)9-8-10-20(28(35)36)26-22-15-24(34)27-29(5)13-12-23(33)18(3)21(29)11-14-30(27,6)31(22,7)16-25(26)37-19(4)32/h9,18,21-22,25,27H,8,10-16H2,1-7H3,(H,35,36)/b26-20-/t18-,21-,22-,25-,27-,29-,30-,31-/m0/s1
InChI key:InChIKey=XHWNFPOLQYKPKS-CNZZPSATSA-N
SMILES:C[C@@]12[C@]3(C)[C@](/C(=C(\CCC=C(C)C)/C(O)=O)/[C@@H](OC(C)=O)C3)(CC(=O)[C@]1([C@]4(C)[C@@](CC2)([C@H](C)C(=O)CC4)[H])[H])[H]
Synonyms:- 3,11-Diketofusidic acid
- (4α,8α,9β,13α,14β,16β,17Z)-16-(Acetyloxy)-3,11-dioxo-29-nordammara-17(20),24-dien-21-oic acid
- 29-Nor-8α,9β,13α,14β-dammara-17(20),24-dien-21-oic acid, 16β-hydroxy-3,11-dioxo-, acetate, (Z)-
- 29-Nordammara-17(20),24-dien-21-oic acid, 16-(acetyloxy)-3,11-dioxo-, (4α,8α,9β,13α,14β,16β,17Z)-
- Fusidic acid, 3,11-dioxo-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.
3,11-Diketofusidic Acid
CAS:Controlled ProductFormula:C31H44O6Color and Shape:NeatMolecular weight:512.68

