
CAS 3483-84-9
:3-Hydroxy-N,N,N-trimethylbenzenaminium
Description:
3-Hydroxy-N,N,N-trimethylbenzenaminium, also known as benzyltrimethylammonium hydroxide, is a quaternary ammonium compound characterized by its positively charged nitrogen atom, which is bonded to three methyl groups and a hydroxyl-substituted aromatic ring. This compound typically appears as a colorless to pale yellow liquid or solid, depending on its form and purity. It is soluble in water and polar organic solvents, making it useful in various applications, including as a surfactant, phase transfer catalyst, and in the synthesis of other chemical compounds. The presence of the hydroxyl group contributes to its reactivity, allowing it to participate in hydrogen bonding and enhancing its solubility in aqueous environments. Additionally, due to its quaternary ammonium structure, it exhibits antimicrobial properties, which can be beneficial in disinfectants and antiseptics. Safety considerations include handling it with care, as it may cause irritation to skin and eyes. Overall, 3-Hydroxy-N,N,N-trimethylbenzenaminium is a versatile compound with significant utility in both industrial and laboratory settings.
Formula:C9H14NO
InChI:InChI=1S/C9H13NO/c1-10(2,3)8-5-4-6-9(11)7-8/h4-7H,1-3H3/p+1
InChI key:InChIKey=CSKWZSUBRGLJBC-UHFFFAOYSA-O
SMILES:[N+](C)(C)(C)C1=CC(O)=CC=C1
Synonyms:- Benzenaminium, 3-hydroxy-N,N,N-trimethyl-
- 3-Hydroxy-N,N,N-trimethylbenzenaminium
- Ammonium, (m-hydroxyphenyl)trimethyl-
- m-Hydroxyphenyltrimethylammonium
- (3-Hydroxyphenyl)trimethylammonium
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 1 products.
Neostige impurity A
CAS:Neostigmine impurity A is a potent inhibitor of kinases that have been implicated in cancer cell growth and tumor progression. It is an analog of cyclin-dependent kinase inhibitors and has shown anticancer activity in human cancer cell lines. Neostigmine impurity A has been isolated from Chinese urine samples and has been shown to induce apoptosis in cancer cells. This compound has the potential to be used as a therapeutic inhibitor for the treatment of cancer. Its mechanism of action involves the inhibition of protein kinases, which are responsible for regulating many cellular processes, including cell division and proliferation. Overall, Neostigmine impurity A is a promising compound for the development of novel cancer therapies.Formula:C9H14NOPurity:Min. 95%Molecular weight:152.21 g/mol
