CAS 3484-33-1
:2-(Methylamino)-5-nitrobenzoic acid
Description:
2-(Methylamino)-5-nitrobenzoic acid, with the CAS number 3484-33-1, is an organic compound characterized by its aromatic structure, which includes a nitro group and a methylamino group attached to a benzoic acid framework. This compound typically appears as a solid and is soluble in polar solvents due to the presence of the carboxylic acid functional group. The methylamino group contributes to its basicity, while the nitro group is known for its electron-withdrawing properties, influencing the compound's reactivity and stability. It is often utilized in organic synthesis and may serve as an intermediate in the production of dyes, pharmaceuticals, or agrochemicals. The presence of both the nitro and amino groups can also impart specific biological activities, making it of interest in medicinal chemistry. As with many nitro compounds, it may require careful handling due to potential toxicity and environmental considerations. Proper safety measures should be observed when working with this substance in laboratory settings.
Formula:C8H8N2O4
InChI:InChI=1S/C8H8N2O4/c1-9-7-3-2-5(10(13)14)4-6(7)8(11)12/h2-4,9H,1H3,(H,11,12)
InChI key:InChIKey=FAVDVRYGVZMEFI-UHFFFAOYSA-N
SMILES:C(O)(=O)C1=C(NC)C=CC(N(=O)=O)=C1
Synonyms:- Anthranilic acid, N-methyl-5-nitro-
- Benzoic Acid, 2-(Methylamino)-5-Nitro-
- N-Methyl-5-nitroanthranilic acid
- 2-(Methylamino)-5-nitrobenzoic acid
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
Benzoic acid,2-(methylamino)-5-nitro-
CAS:Formula:C8H8N2O4Purity:98%Color and Shape:SolidMolecular weight:196.16012-(Methylamino)-5-nitrobenzoic acid
CAS:2-(Methylamino)-5-nitrobenzoic acidFormula:C8H8N2O4Purity:≥95%Color and Shape: yellow powderMolecular weight:196.16g/mol2-(Methylamino)-5-nitrobenzoic acid
CAS:2-(Methylamino)-5-nitrobenzoic acid is a benzimidazole that contains a planar, aromatic ring and an amino group in the side chain. The compound is a hydrogen bond donor and acceptor. It undergoes oxidative cyclisations to form benzoic acids from anilines, which are generated through hydrogen atom abstraction. 2-(Methylamino)-5-nitrobenzoic acid also reacts with other aromatic compounds to form dimers or benzoic acids.
Formula:C8H8N2O4Purity:Min. 95%Molecular weight:196.16 g/molRef: 3D-DAA48433
Discontinued product



