CAS 34841-09-3

3-Amino-3-(3,4-dimethoxyphenyl)propionic acid

Description:

3-Amino-3-(3,4-dimethoxyphenyl)propionic acid, with the CAS number 34841-09-3, is an amino acid derivative characterized by the presence of an amino group and a propionic acid backbone. This compound features a phenyl ring that is substituted with two methoxy groups at the 3 and 4 positions, which enhances its lipophilicity and may influence its biological activity. The presence of the amino group allows for potential interactions in biological systems, making it of interest in medicinal chemistry and pharmacology. Its structural features suggest that it may participate in hydrogen bonding and other intermolecular interactions, which could affect its solubility and reactivity. Additionally, the methoxy groups can contribute to the compound's electronic properties, potentially impacting its behavior in various chemical environments. Overall, 3-Amino-3-(3,4-dimethoxyphenyl)propionic acid is a compound that may have applications in research related to neurotransmitter modulation or as a building block in the synthesis of more complex molecules.

Formula: C₁₁H₁₅NO₄

InChI: InChI=1/C11H15NO4/c1-15-9-4-3-7(5-10(9)16-2)8(12)6-11(13)14/h3-5,8H,6,12H2,1-2H3,(H,13,14)

SMILES: COc1ccc(cc1OC)C(CC(=O)O)N

Synonyms:

• Benzenepropanoic acid, beta-amino-3,4-dimethoxy-
• 3-Amino-3-(3,4-Dimethoxyphenyl)Propanoic Acid

3-Amino-3-(3,4-dimethoxyphenyl)propionic Acid

CAS: 34841-09-3

Formula: C₁₁H₁₅NO₄

Purity: >98.0%(T)(HPLC)

Color and Shape: White to Almost white powder to crystal

Molecular weight: 225.24

Ref: 3B-A2536

3-Amino-3-(3,4-dimethoxyphenyl)propionic acid

CAS: 34841-09-3

Formula: C₁₁H₁₅NO₄

Purity: 97%

Color and Shape: Solid

Molecular weight: 225.2411

Ref: IN-DA00396V

3-Amino-3-(3,4-dimethoxyphenyl)propanoic acid

CAS: 34841-09-3

3-Amino-3-(3,4-dimethoxyphenyl)propanoic acid

Purity: 98%

Molecular weight: 225.24g/mol

Ref: 54-OR95306