CAS 34849-42-8
:Cyclafuramid
Description:
Cyclafuramid, with the CAS number 34849-42-8, is a chemical compound that belongs to the class of insecticides and acaricides. It is characterized by its unique molecular structure, which includes a cyclopropane ring and a sulfonamide group, contributing to its biological activity. Cyclafuramid is known for its effectiveness against a variety of pests, particularly in agricultural settings, where it is used to protect crops from harmful insects. The compound operates through a specific mode of action that disrupts the nervous system of target organisms, leading to their mortality. It is typically applied in formulations that enhance its stability and efficacy. Additionally, Cyclafuramid has been evaluated for its environmental impact and safety profile, with studies assessing its persistence in soil and potential effects on non-target species. As with many agrochemicals, proper handling and application are essential to minimize risks to human health and the environment. Overall, Cyclafuramid represents a significant tool in integrated pest management strategies.
Formula:C13H19NO2
InChI:InChI=1S/C13H19NO2/c1-9-8-12(10(2)16-9)13(15)14-11-6-4-3-5-7-11/h8,11H,3-7H2,1-2H3,(H,14,15)
InChI key:InChIKey=OYRIKLVYHTWHCZ-UHFFFAOYSA-N
SMILES:C(NC1CCCCC1)(=O)C2=C(C)OC(C)=C2
Synonyms:- 3-Furancarboxamide, N-cyclohexyl-2,5-dimethyl-
- Bas 3270
- Bas 3270F
- Bas 3271F
- Cyclafuramid
- Cyclafuramid [ISO]
- Cyclafuramide
- N-Cyclohexyl-2,5-dimethyl-3-furancarboxamide
- N-Cyclohexyl-2,5-dimethylfuran-3-carbonic acid amide
- N-cyclohexyl-2,5-dimethylfuran-3-carboxamide
- N-Cyclohexyl-2,5-dimethyl-3-furamide
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
