CAS 3486-66-6
:Coptisine
Description:
Coptisine is a natural alkaloid primarily derived from various plants, particularly those in the Berberidaceae family, such as Coptis chinensis. It is characterized by its yellow crystalline appearance and is known for its bioactive properties. Coptisine exhibits a range of pharmacological activities, including antimicrobial, anti-inflammatory, and antioxidant effects, making it of interest in medicinal chemistry and herbal medicine. The compound has a complex structure, featuring a protoberberine skeleton, which contributes to its biological activity. Coptisine has been studied for its potential therapeutic applications, particularly in the treatment of various diseases, including infections and metabolic disorders. Additionally, it has shown promise in modulating certain cellular pathways, which may have implications for cancer research. However, further studies are needed to fully understand its mechanisms of action and potential side effects. As with many natural compounds, the extraction and purification processes can influence its efficacy and stability, highlighting the importance of proper handling in research and application.
Formula:C19H14NO4
InChI:InChI=1S/C19H14NO4/c1-2-16-19(24-10-21-16)14-8-20-4-3-12-6-17-18(23-9-22-17)7-13(12)15(20)5-11(1)14/h1-2,5-8H,3-4,9-10H2/q+1
InChI key:InChIKey=XYHOBCMEDLZUMP-UHFFFAOYSA-N
SMILES:C1=2C=3C(=CC4=C(C3)OCO4)CC[N+]1=CC=5C(C2)=CC=C6C5OCO6
Synonyms:- 6,7-Dihydrobis[1,3]benzodioxolo[5,6-a:4′,5′-g]quinolizinium
- Alkaloid A, from Coptisgroenlandica
- Alkaloid A, fromCoptis groenlandica
- Berbinium,7,8,13,13a-tetradehydro-2,3:9,10-bis(methylenedioxy)-
- Bis[1,3]benzodioxolo[5,6-a:4',5'-g]quinolizinium,6,7-dihydro-
- Bis[1,3]benzodioxolo[5,6-a:4′,5′-g]quinolizinium, 6,7-dihydro-
- Coptisin
- Yhl Ii
- Coptisine
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
Coptisine
CAS:<p>Coptisine is an alkaloid that has shown significant cytotoxicity against a variety of tumor cell lines, including myeloma cell lines. Coptisine also has anti-inflammatory activity and inhibits the toll-like receptor signaling pathway. Coptisine is a natural compound with chemical properties that are similar to berberine and other alkaloids. The biological properties of coptisine have been studied in detail, such as its ability to inhibit polymerase chain reaction (PCR) and interfere with mitochondrial membrane potential. Coptisine is found in plants such as Coptis chinensis and Cephalotaxus fortunei.</p>Formula:C19H14NO4Purity:Min. 95%Color and Shape:Off-White PowderMolecular weight:320.32 g/mol
