CAS 3486-67-7
:Palmatine
Description:
Palmatine, with the CAS number 3486-67-7, is a natural alkaloid belonging to the class of compounds known as isoquinoline alkaloids. It is primarily derived from various plant sources, including the bark of the Palmatum tree and other species in the Berberidaceae family. Palmatine is characterized by its yellow crystalline appearance and has a molecular formula that reflects its complex structure. This compound exhibits a range of biological activities, including antimicrobial, anti-inflammatory, and potential anticancer properties, making it of interest in pharmacological research. Palmatine is also known for its role in traditional medicine, particularly in certain cultures where it is used for its therapeutic effects. Its solubility varies in different solvents, and it can undergo various chemical reactions, including oxidation and reduction, which are relevant for its applications in organic synthesis and medicinal chemistry. Overall, palmatine is a significant compound in both natural product chemistry and pharmacology, warranting further investigation into its potential health benefits and mechanisms of action.
Formula:C21H22NO4
InChI:InChI=1S/C21H22NO4/c1-23-18-6-5-13-9-17-15-11-20(25-3)19(24-2)10-14(15)7-8-22(17)12-16(13)21(18)26-4/h5-6,9-12H,7-8H2,1-4H3/q+1
InChI key:InChIKey=QUCQEUCGKKTEBI-UHFFFAOYSA-N
SMILES:O(C)C=1C=C2C=3[N+](=CC=4C(C3)=CC=C(OC)C4OC)CCC2=CC1OC
Synonyms:- 2,3,9,10-Tetramethoxy-5,6-Dihydroisoquino[3,2-A]Isoquinolinium
- 2,3,9,10-Tetramethoxy-5,6-dihydroisoquinolino[2,1-b]isoquinolin-7-ium
- 2,3,9,10-Tetramethoxyisoquinolino[3,2-A]Isoquinolin-7-Ium Hydrate
- 5,6-Dihydro-2,3,9,10-tetramethoxydibenzo(a,g)quinolizinium
- 7,8,13,13a-Tetrahydro-2,3,9,10-tetramethoxyberbinium
- Berbericinine
- Berbinium, 7,8,13,13a-tetradehydro-2,3,9,10-tetramethoxy-
- Berbinium, 7,8,13,13a-tetrahydro-2,3,9,10-tetramethoxy-
- Brn 1555498
- Common fibraurea stem
- Depiline
- Dibenzo(a,g)quinolizinium, 5,6-dihydro-2,3,9,10-tetramethoxy-
- Fibrauretin
- Fibrauretine
- Huang Teng Su
- O,O-Dimethyldemethyleneberberine
- Palmatin
- Unii-G50C034217
- 5-21-06-00202 (Beilstein Handbook Reference)
- See more synonyms
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 7 products.
Dibenzo[a,g]quinolizinium, 5,6-dihydro-2,3,9,10-tetramethoxy-
CAS:Formula:C21H22NO4Purity:97%Color and Shape:SolidMolecular weight:352.4037Palmatine
CAS:Formula:C21H22NO4Purity:≥ 98.0%Color and Shape:Off-white to yellow powderMolecular weight:352.40Palmatine
CAS:Palmatine , a protoberberine alkaloid, is present in preparations from medicinal plants such as Coptis chinensis and Corydalis yanhusuo, palmatine activates the AhR-CYP1A pathway in HepG2 monolayer, while the potential for CYP1A induction is irrelevant in cell systems which are closer to the in vivo situation, i.e. in HepG2 spheroids and primary cultures of human hepatocytes.Formula:C21H22NO4Purity:95%~99%Color and Shape:Yellow PowderMolecular weight:352.409Palmatine
CAS:Palmatine, also known as Burasaine, inhibits dopamine production and may treat flavivirus, jaundice, dysentery, hypertension, and liver issues.Formula:C21H22NO4Purity:96.28% - 99.49%Color and Shape:SolidMolecular weight:352.4Palmatine
CAS:Palmatine is an isoquinoline alkaloid, which is primarily sourced from various plants such as Coptis chinensis, Berberis, and Phellodendron species. It exerts its biological effects mainly through modulation of inflammatory pathways, inhibition of bacterial proliferation, and interaction with specific cellular receptors. The compound exhibits multiple pharmacological activities due to its ability to intercalate with DNA and inhibit nucleic acid synthesis.Formula:C21H22NO4Purity:Min. 95%Color and Shape:Yellow PowderMolecular weight:352.4 g/mol





