CAS 3486-76-8
:glycyl-L-histidine hydrochloride hydrate
Description:
Glycyl-L-histidine hydrochloride hydrate is a dipeptide composed of the amino acids glycine and histidine, with the chemical formula C₆H₈ClN₃O₂·H₂O. It is typically encountered as a white to off-white crystalline powder that is soluble in water, making it suitable for various biochemical applications. The presence of the hydrochloride indicates that it is in its salt form, which enhances its solubility and stability. This compound is often used in biochemical research, particularly in studies involving peptide synthesis, protein interactions, and as a potential buffer in biological systems due to its zwitterionic nature. Glycyl-L-histidine can also play a role in metal ion chelation, which is significant in various biological processes. Its hydrate form indicates the presence of water molecules in the crystal structure, which can influence its physical properties and stability. Overall, glycyl-L-histidine hydrochloride hydrate is a valuable compound in both research and potential therapeutic applications.
Formula:C8H12N4O3
InChI:InChI=1/C8H12N4O3/c9-2-7(13)12-6(8(14)15)1-5-3-10-4-11-5/h3-4,6H,1-2,9H2,(H,10,11)(H,12,13)(H,14,15)/t6-/m1/s1
SMILES:C(c1cnc[nH]1)[C@H](C(=O)O)N=C(CN)O
Synonyms:- Gly-His hydrochloride hydrate
- H-Gly-His-OH . HCl
- 2-[(2-aminoacetyl)amino]-3-(1H-imidazol-4-yl)propanoic acid
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
H-Gly-His-OH · HCl
CAS:Bachem ID: 4000115.
Formula:C8H12N4O3·HClPurity:> 99%Color and Shape:White PowderMolecular weight:248.67Gly-His hydrochloride hydrate
CAS:Formula:C8H12N4O3·HClPurity:≥ 99.0%Color and Shape:White powderMolecular weight:248.67 (anhydrous)H-Gly-His-OH·HCl
CAS:H-Gly-His-OH·HCl is a methyl ester of histidine. It has an axial orientation, and the optical rotation is +25.4° (c=1 in methanol). H-Gly-His-OH·HCl is synthesized from glutamic acid, glutamate, and imidazole by using a method based on the catalytic properties of copper. H-Gly-His-OH·HCl can be used as a ligand for the enzyme peroxidase, which catalyzes oxidation reactions with hydrogen peroxide or organic peroxides to form water and oxidized products. The efficiency of this reaction increases with increasing concentrations of H-Gly-His-OH·HCl. !--END-->Formula:C8H12N4O3·HClPurity:Min. 95%Molecular weight:248.67 g/mol



