CAS 348640-02-8

1-[(4-methylphenyl)sulfonyl]-1H-pyrrolo[2,3-b]pyridine

Description:

1-[(4-methylphenyl)sulfonyl]-1H-pyrrolo[2,3-b]pyridine, identified by its CAS number 348640-02-8, is a chemical compound characterized by its unique structural features, which include a pyrrolo[2,3-b]pyridine core and a sulfonyl group attached to a 4-methylphenyl moiety. This compound typically exhibits properties such as moderate to high solubility in organic solvents, which is common for many heterocyclic compounds. Its sulfonyl group contributes to its potential reactivity and biological activity, making it of interest in medicinal chemistry and drug development. The presence of the pyridine and pyrrole rings suggests potential interactions with biological targets, possibly influencing its pharmacological profile. Additionally, the compound may exhibit specific spectral characteristics in techniques such as NMR and IR spectroscopy, aiding in its identification and characterization. Overall, this compound's unique structure and functional groups position it as a candidate for further research in various chemical and pharmaceutical applications.

Formula: C₁₄H₁₂N₂O₂S

InChI: InChI=1/C14H12N2O2S/c1-11-4-6-13(7-5-11)19(17,18)16-10-8-12-3-2-9-15-14(12)16/h2-10H,1H3

SMILES: Cc1ccc(cc1)S(=O)(=O)n1ccc2cccnc12

Synonyms:

• 1-[(4-Methylphenyl)sulfonyl]-1H-pyrrolo[2,3-b]pyridin
• 1H-pyrrolo[2,3-b]pyridine, 1-[(4-methylphenyl)sulfonyl]-

1H-Pyrrolo[2,3-b]pyridine, 1-[(4-methylphenyl)sulfonyl]-

CAS: 348640-02-8

Formula: C₁₄H₁₂N₂O₂S

Purity: 98%

Color and Shape: Solid

Molecular weight: 272.3223

Ref: IN-DA00C6CA

1-Tosyl-1H-pyrrolo[2,3-b]pyridine

CAS: 348640-02-8

1-Tosyl-1H-pyrrolo[2,3-b]pyridine

Purity: 98%

Molecular weight: 272.32g/mol

Ref: 54-OR95787

1-Tosyl-1H-pyrrolo[2,3-b]pyridine

CAS: 348640-02-8

Purity: 95.0%

Color and Shape: Liquid, No data available.

Molecular weight: 272.32000732421875

Ref: 10-F221262