CymitQuimica logo

CAS 348640-05-1

:

4-chloro-1-(phenylsulfonyl)-1H-pyrrolo[2,3-b]pyridine

Description:
4-Chloro-1-(phenylsulfonyl)-1H-pyrrolo[2,3-b]pyridine is a chemical compound characterized by its unique pyrrolopyridine structure, which incorporates a chloro group and a phenylsulfonyl moiety. This compound typically exhibits a molecular formula that reflects its complex structure, contributing to its potential biological activity. It is often studied for its pharmacological properties, particularly in the context of medicinal chemistry, where such compounds may serve as lead structures for drug development. The presence of the chloro substituent can influence its reactivity and solubility, while the phenylsulfonyl group may enhance its interaction with biological targets. Additionally, this compound may exhibit specific physical properties such as melting point and solubility characteristics that are relevant for its application in research and industry. Safety and handling considerations are essential, as with many chemical substances, due to potential toxicity or reactivity. Overall, 4-chloro-1-(phenylsulfonyl)-1H-pyrrolo[2,3-b]pyridine represents a significant compound in the field of organic and medicinal chemistry.
Formula:C14H11ClN2O2S
InChI:InChI=1/C14H11ClN2O2S/c1-10-2-4-11(5-3-10)20(18,19)17-9-7-12-13(15)6-8-16-14(12)17/h2-9H,1H3
InChI key:RXOUGGMZMDZDCE-UHFFFAOYSA-N
SMILES:Cc1ccc(cc1)S(=O)(=O)n1ccc2c(ccnc12)Cl
Synonyms:
  • 1H-pyrrolo[2,3-b]pyridine, 4-chloro-1-(phenylsulfonyl)-
  • 4-Chlor-1-(phenylsulfonyl)-1H-pyrrolo[2,3-b]pyridin
  • 4-chloro-1-[(4-methylphenyl)sulfonyl]-1H-pyrrolo[2,3-b]pyridine
  • 1-(benzenesulfonyl)-4-chloro-1H-pyrrolo[2,3-b]pyridine
Found 4 products.