CAS 34883-39-1
:2,5-Dichlorobiphenyl
Description:
2,5-Dichlorobiphenyl is an organic compound belonging to the biphenyl family, characterized by the presence of two chlorine atoms attached to the biphenyl structure at the 2 and 5 positions. It is a colorless to pale yellow solid at room temperature and is relatively insoluble in water but soluble in organic solvents such as benzene and chloroform. This compound exhibits a melting point that typically falls within a moderate range, and its boiling point is significantly higher, reflecting its stable aromatic structure. 2,5-Dichlorobiphenyl is known for its chemical stability and resistance to degradation, which can lead to environmental persistence. It is primarily used in industrial applications, including as a precursor in the synthesis of other chemicals and as a potential intermediate in the production of various chlorinated compounds. However, like many chlorinated biphenyls, it may pose environmental and health risks, necessitating careful handling and regulation due to its potential toxicity and bioaccumulation in ecosystems.
Formula:C12H8Cl2
InChI:InChI=1S/C12H8Cl2/c13-10-6-7-12(14)11(8-10)9-4-2-1-3-5-9/h1-8H
InChI key:InChIKey=KKQWHYGECTYFIA-UHFFFAOYSA-N
SMILES:ClC1=C(C=C(Cl)C=C1)C2=CC=CC=C2
Synonyms:- 1,1'-Biphenyl, 2,5-Dichloro-
- 1,4-Dichloro-2-phenylbenzene
- 2,5-Dichloro-1,1′-biphenyl
- 2,5-Pcb
- 3,6-Dichlorobiphenyl
- 34883-39-1
- Biphenyl, 2,5-dichloro-
- Pcb 9
- 2,5-Dichlorobiphenyl
- 2,5-Dichlorobiphenyl
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
