CAS 34896-80-5
:3-Bromophenyl methyl sulfone
Description:
3-Bromophenyl methyl sulfone, with the CAS number 34896-80-5, is an organic compound characterized by the presence of a bromine atom attached to a phenyl ring, along with a methyl sulfone functional group. This compound typically exhibits a white to off-white crystalline appearance and is soluble in polar organic solvents. The sulfone group contributes to its polar nature, enhancing its reactivity in various chemical reactions, such as nucleophilic substitutions. The presence of the bromine atom can also influence its reactivity, making it a useful intermediate in organic synthesis, particularly in the development of pharmaceuticals and agrochemicals. Additionally, 3-bromophenyl methyl sulfone may exhibit biological activity, which can be explored in medicinal chemistry. Its stability under standard conditions allows for its use in various applications, although care should be taken due to potential toxicity associated with brominated compounds. Overall, this compound serves as an important building block in synthetic organic chemistry.
Formula:C7H7BrO2S
InChI:InChI=1/C7H7BrO2S/c1-11(9,10)7-4-2-3-6(8)5-7/h2-5H,1H3
SMILES:CS(=O)(=O)c1cccc(c1)Br
Synonyms:- 3-Bromo phenyl methyl sulfone
- 1-Bromo-3-(Methylsulfonyl)Benzene
- 3-Bromophenyl methyl sulphone
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
3-Bromophenyl Methyl Sulfone
CAS:Formula:C7H7BrO2SPurity:>98.0%(GC)Color and Shape:White to Light yellow powder to crystalMolecular weight:235.101-Bromo-3-(methylsulfonyl)benzene
CAS:Formula:C7H7BrO2SPurity:97%Color and Shape:SolidMolecular weight:235.09833-Bromophenyl methyl sulphone
CAS:3-Bromophenyl methyl sulphoneFormula:C7H7BrO2SPurity:≥95%Color and Shape: white crystalline powderMolecular weight:235.10g/mol3-Bromophenylmethylsulfone
CAS:Formula:C7H7BrO2SPurity:98%Color and Shape:SolidMolecular weight:235.13-Bromophenylmethyl Sulfone
CAS:Controlled ProductFormula:C7H7BrO2SColor and Shape:NeatMolecular weight:235.11-Bromo-3-methanesulfonyl(1,2,3,4,5,6-13C6)benzene
CAS:Controlled ProductFormula:C6CH7BrO2SColor and Shape:NeatMolecular weight:241.054




