CAS 349-00-8
:N-(trifluoroacetyl)valine
Description:
N-(trifluoroacetyl)valine is an organic compound characterized by the presence of a valine amino acid structure modified with a trifluoroacetyl group. This compound features a central carbon backbone typical of amino acids, with an amino group (-NH2) and a carboxylic acid group (-COOH), which are characteristic of valine. The trifluoroacetyl group, consisting of a carbonyl (C=O) bonded to a trifluoromethyl group (CF3), imparts unique chemical properties, including increased lipophilicity and potential reactivity in various chemical reactions. N-(trifluoroacetyl)valine is often utilized in peptide synthesis and as a building block in medicinal chemistry due to its ability to influence the biological activity of peptides. The presence of fluorine atoms enhances the compound's stability and can affect its interaction with biological targets. Additionally, this compound is typically handled with care due to the potential toxicity associated with trifluoroacetyl derivatives. Overall, N-(trifluoroacetyl)valine serves as an important tool in both synthetic and pharmaceutical chemistry.
Formula:C7H10F3NO3
InChI:InChI=1/C7H10F3NO3/c1-3(2)4(5(12)13)11-6(14)7(8,9)10/h3-4H,1-2H3,(H,11,14)(H,12,13)
SMILES:CC(C)C(C(=O)O)N=C(C(F)(F)F)O
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
(2S)-3-Methyl-2-(trifluoroacetamido)butanoic acid
CAS:Formula:C7H10F3NO3Purity:97%Color and Shape:SolidMolecular weight:213.1544N-(2,2,2-Trifluoroacetyl)-L-valine
CAS:N-(2,2,2-Trifluoroacetyl)-L-valinePurity:97%Molecular weight:213.15g/mol(2S)-3-Methyl-2-(trifluoroacetamido)butanoic acid
CAS:(2S)-3-Methyl-2-(trifluoroacetamido)butanoic acid is an acid that is used as a precursor to other organic compounds. It is also known as trifluoroacetic acid, which has an acidic side chain. (2S)-3-Methyl-2-(trifluoroacetamido)butanoic acid can be synthesized by the condensation of indole-3-pyruvic acid and amines. This chemical compound also has chromatographic properties, hydroxyl group, tetrahydropyran, dehydration, nucleophilic, imine, anilines and oxazolones. (2S)-3-Methyl-2-(trifluoroacetamido)butanoic acid contains an amino function and aldehyde groups.Formula:C7H10F3NO3Purity:Min. 95%Molecular weight:213.15 g/mol



