CAS 349-01-9

2,4-dinitro-5-fluorotoluene

Description:

2,4-Dinitro-5-fluorotoluene, with the CAS number 349-01-9, is an aromatic nitro compound characterized by the presence of two nitro groups and a fluorine atom attached to a toluene ring. This compound typically appears as a yellow crystalline solid and is known for its relatively high stability under standard conditions. It has a moderate solubility in organic solvents, such as acetone and ethanol, but is less soluble in water. The presence of nitro groups contributes to its potential as an explosive material, while the fluorine atom can enhance its chemical reactivity and influence its physical properties. 2,4-Dinitro-5-fluorotoluene is primarily used in research and industrial applications, particularly in the synthesis of other chemical compounds. Safety precautions are necessary when handling this substance due to its toxic and potentially hazardous nature, including risks associated with exposure and environmental impact. Proper storage and disposal methods should be followed to mitigate any risks.

Formula: C₇H₅FN₂O₄

InChI: InChI=1/C7H5FN2O4/c1-4-2-5(8)7(10(13)14)3-6(4)9(11)12/h2-3H,1H3

SMILES: Cc1cc(c(cc1N(=O)=O)N(=O)=O)F

Synonyms:

• 1-Fluoro-5-methyl-2,4-dinitrobenzene

2,4-DINITRO-5-FLUOROTOLUENE

CAS: 349-01-9

Formula: C₇H₅FN₂O₄

Purity: 95%

Color and Shape: Solid

Molecular weight: 200.1240

Ref: IN-DA00C0IF

2,4-Dinitro-5-fluorotoluene

CAS: 349-01-9

2,4-Dinitro-5-fluorotoluene

Formula: C₇H₅FN₂O₄

Purity: 99%

Color and Shape: faint yellow crystalline powder

Molecular weight: 200.12g/mol

Ref: 54-PC3041

2,4-Dinitro-5-fluorotoluene

CAS: 349-01-9

2,4-Dinitro-5-fluorotoluene is a fine chemical that can be used as a versatile building block in the synthesis of complex compounds. It is an intermediate in many reactions involving aliphatic nitro compounds and has been shown to be reactive with aromatic amines. This chemical has been used as a research chemical for the detection of proteins and nucleic acids and is also a good reagent for the synthesis of other chemicals. The compound reacts quickly with acid to produce a highly explosive gas which can be stabilized by reacting it with potassium nitrate or sodium bicarbonate.

Formula: C₇H₅FN₂O₄

Purity: Min. 95%

Color and Shape: Powder

Molecular weight: 200.12 g/mol

Ref: 3D-FD67959

2,4-Dinitro-5-fluorotoluene

CAS: 349-01-9

Formula: C₇H₅FN₂O₄

Purity: 95%

Color and Shape: Solid, Powder

Molecular weight: 200.125

Ref: 10-F004969