CAS 349-50-8
:(Chlorodifluoromethyl)benzene
Description:
(Chlorodifluoromethyl)benzene, also known as benzene, (chlorodifluoromethyl)-, is an aromatic compound characterized by the presence of a benzene ring substituted with a chlorodifluoromethyl group. Its molecular formula is C8H6ClF2, and it features a unique combination of chlorine and fluorine atoms, which contribute to its chemical reactivity and physical properties. This compound is typically a colorless liquid with a distinctive odor, and it is known for its volatility and low solubility in water. The presence of the chlorodifluoromethyl group enhances its potential applications in various fields, including organic synthesis and as an intermediate in the production of other chemical compounds. However, due to the halogenated nature of the compound, it may pose environmental and health risks, necessitating careful handling and disposal. Its properties, such as boiling point, melting point, and density, can vary based on specific conditions and purity levels. Overall, (chlorodifluoromethyl)benzene is a significant compound in the realm of synthetic organic chemistry.
Formula:C7H5ClF2
InChI:InChI=1S/C7H5ClF2/c8-7(9,10)6-4-2-1-3-5-6/h1-5H
InChI key:InChIKey=RPSUKAMDJCKXAF-UHFFFAOYSA-N
SMILES:C(Cl)(F)(F)C1=CC=CC=C1
Synonyms:- (Chlorodifluoromethyl)benzene
- Benzene, (Chlorodifluoromethyl)-
- Toluene, α-chloro-α,α-difluoro-
- α,α-Difluoro-α-chlorotoluene
- α-Chloro-α,α-difluorotoluene
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
[Chloro(difluoro)methyl]benzene
CAS:<p>[Chloro(difluoro)methyl]benzene</p>Formula:C7H5ClF2Purity:≥95%Color and Shape: clear. colourless liquidMolecular weight:162.56g/mol(Chlorodifluoromethyl)benzene
CAS:Formula:C7H5ClF2Purity:95.0%Color and Shape:ClearMolecular weight:162.56[chloro(difluoro)methyl]benzene
CAS:<p>Hexamethylphosphoramide is a liquid crystal composition that can be used to produce polymerizable materials. It is a colorless, odorless and toxic liquid at room temperature. Hexamethylphosphoramide contains six nitrogen atoms, which are nucleophilic and can react with hydrogen chloride or chlorine atom in the reaction solution to form an elimination product. This process is accompanied by the release of heat and radiation. Hexamethylphosphoramide forms polymers with aluminium and hydrogen fluoride as the initiator. The elimination rate is high for this compound under radiation, which allows it to be used as a polymerization initiator. Hexamethylphosphoramide also reacts with aromatic hydrocarbons to form chloro(difluoro)methylbenzene</p>Formula:C7H5ClF2Purity:Min. 95%Molecular weight:162.56 g/mol


