CAS 349-60-0

3,5-Bis(trifluoromethyl)anisole

Description:

3,5-Bis(trifluoromethyl)anisole, with the CAS number 349-60-0, is an organic compound characterized by its aromatic structure, which includes a methoxy group and two trifluoromethyl groups attached to a benzene ring. This compound is typically a colorless to pale yellow liquid or solid, depending on the temperature. It exhibits significant hydrophobicity due to the presence of the trifluoromethyl groups, which also contribute to its high electronegativity and unique reactivity. The trifluoromethyl groups enhance the compound's stability and influence its physical properties, such as boiling and melting points. 3,5-Bis(trifluoromethyl)anisole is often used in various chemical syntheses and may serve as an intermediate in the production of pharmaceuticals or agrochemicals. Its distinct electronic properties make it a valuable compound in materials science and organic synthesis. Additionally, it is important to handle this substance with care, as it may pose environmental and health risks if not managed properly.

Formula: C₉H₆F₆O

InChI: InChI=1/C9H6F6O/c1-16-7-3-5(8(10,11)12)2-6(4-7)9(13,14)15/h2-4H,1H3

SMILES: COc1cc(cc(c1)C(F)(F)F)C(F)(F)F

Synonyms:

• 1-Methoxy-3,5-Bis(Trifluoromethyl)Benzene

3,5-Bis(trifluoromethyl)anisole

CAS: 349-60-0

Formula: C₉H₆F₆O

Purity: 98%

Color and Shape: Liquid

Molecular weight: 244.1338

Ref: IN-DA00C0I0

3,5-Bis(trifluoromethyl)anisole

CAS: 349-60-0

3,5-Bis(trifluoromethyl)anisole

Formula: C₉H₆F₆O

Purity: 98%

Color and Shape: clear. colourless liquid

Molecular weight: 244.13g/mol

Ref: 54-PC9670

3,5-Bis(trifluoromethyl)anisole

CAS: 349-60-0

Formula: C₉H₆F₆O

Purity: 97%

Color and Shape: Liquid

Molecular weight: 244.136

Ref: 10-F005567