CAS 349-95-1
:4-(Trifluoromethyl)benzenemethanol
Description:
4-(Trifluoromethyl)benzenemethanol, also known as benzyl 4-(trifluoromethyl)phenylmethanol, is an organic compound characterized by the presence of a trifluoromethyl group attached to a benzene ring, along with a hydroxymethyl group. This compound typically appears as a colorless to pale yellow liquid or solid, depending on its purity and temperature. It is known for its relatively low volatility and moderate solubility in organic solvents, while being less soluble in water due to its hydrophobic aromatic structure. The trifluoromethyl group imparts unique electronic properties, enhancing the compound's reactivity and making it useful in various chemical syntheses and applications, including pharmaceuticals and agrochemicals. Additionally, the presence of the hydroxymethyl group allows for potential hydrogen bonding interactions, influencing its physical and chemical behavior. Safety data indicates that it should be handled with care, as it may pose health risks upon exposure. Overall, 4-(Trifluoromethyl)benzenemethanol is a valuable compound in organic chemistry with distinct characteristics stemming from its functional groups.
Formula:C8H7F3O
InChI:InChI=1S/C8H7F3O/c9-8(10,11)7-3-1-6(5-12)2-4-7/h1-4,12H,5H2
InChI key:InChIKey=MOOUWXDQAUXZRG-UHFFFAOYSA-N
SMILES:C(F)(F)(F)C1=CC=C(CO)C=C1
Synonyms:- (4-Trifluoromethylphenyl)methanol
- 4-(Trifluoromethyl)benzenemethanol
- 4-Trifluoromethyl Benzene Methanol
- Acetamide, N-[4-(trifluoromethyl)phenyl]-
- Benzenemethanol, 4-(trifluoromethyl)-
- Benzyl alcohol, p-(trifluoromethyl)-
- N-[4-(Trifluoromethyl)phenyl]acetamide
- N1-[4-(trifluoromethyl)phenyl]acetamide
- [4-(Trifluoromethyl)Phenyl]Methanol
- p-(Trifluoromethyl)benzyl alcohol
- p-(Trifluoromethyl)phenylmethanol
- 4-(Trifluoromethyl)-Benzyl Alcohol
- See more synonyms
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
4-(Trifluoromethyl)benzyl Alcohol
CAS:Formula:C8H7F3OPurity:>96.0%(GC)Color and Shape:White or Colorless to Light yellow powder to lump to clear liquidMolecular weight:176.144-(Trifluoromethyl)benzyl alcohol, 98%
CAS:4-(Trifluoromethyl)benzyl alcohol, is used as a pharmaceutical intermediate, it is also used to predict the NMR spectrum. 4-(Trifluoromethyl)benzyl alcohol is employed as a reagent in, for example, kinetic studies of phosphonoformate prodrugs and aquachromium(IV). This Thermo Scientific Chemicals brFormula:C8H7F3OPurity:98%Color and Shape:Liquid, Clear colorlessMolecular weight:176.144-Hydroxymethylbenzotrifluoride
CAS:Formula:C8H7F3OPurity:97%Color and Shape:LiquidMolecular weight:176.13584-(Trifluoromethyl)benzyl alcohol
CAS:4-(Trifluoromethyl)benzyl alcoholFormula:C8H7F3OPurity:98%Color and Shape: light pink liquidMolecular weight:176.14g/mol4-(Trifluoromethyl)benzyl alcohol
CAS:Formula:C8H7F3OPurity:97%Color and Shape:Low Melting SolidMolecular weight:176.138




