CAS 3490-92-4
:methyl 2-cyano-3,3-di(methylthio)acrylate
Description:
Methyl 2-cyano-3,3-di(methylthio)acrylate is an organic compound characterized by its acrylate structure, which includes a cyano group and two methylthio substituents. This compound typically appears as a colorless to pale yellow liquid and is known for its reactivity, particularly in polymerization processes. The presence of the cyano group contributes to its electron-withdrawing properties, enhancing its ability to participate in nucleophilic reactions. The methylthio groups can influence the compound's solubility and stability, making it useful in various chemical applications, including as a building block in organic synthesis and in the production of polymers. Additionally, this compound may exhibit moderate toxicity, necessitating careful handling and appropriate safety measures during use. Its unique structure allows for potential applications in materials science, particularly in the development of specialty chemicals and advanced materials. Overall, methyl 2-cyano-3,3-di(methylthio)acrylate is a versatile compound with significant implications in synthetic organic chemistry.
Formula:C7H9NO2S2
InChI:InChI=1/C7H9NO2S2/c1-10-6(9)5(4-8)7(11-2)12-3/h1-3H3
SMILES:COC(=O)C(=C(SC)SC)C#N
Synonyms:- Methyl 2-Cyano-3,3-Bis(Methylsulfanyl)Prop-2-Enoate
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
Methyl 2-Cyano-3,3-bis(methylthio)acrylate
CAS:Purity:97.0%Color and Shape:SolidMolecular weight:203.27000427246094Methyl 3,3-bis(methylthio)-2-cyanoacrylate
CAS:Methyl 3,3-bis(methylthio)-2-cyanoacrylateFormula:C7H9NO2S2Purity:95%Color and Shape: white solidMolecular weight:203.28g/molMethyl 3,3-bis(methylthio)-2-cyanoacrylate
CAS:Methyl 3,3-bis(methylthio)-2-cyanoacrylate is a diphenyl ether that is used as a bactericide. It has been shown to be effective against both Gram-positive and Gram-negative bacteria. Methyl 3,3-bis(methylthio)-2-cyanoacrylate is synthesized by the reaction of malonate with dimethylamine chloride in the presence of hydrochloric acid salt in order to produce chloride ions. The reaction is then heated, which causes the methyl 3,3-bis(methylthio)-2-cyanoacrylate to form. This compound is soluble in organic solvents such as formic acid and can be purified by recrystallization or by distillation.Formula:C7H9NO2S2Purity:Min. 95%Molecular weight:203.28 g/mol


