CAS 34905-03-8

3-(2-Propyn-1-yloxy)benzenemethanol

Description:

3-(2-Propyn-1-yloxy)benzenemethanol, identified by its CAS number 34905-03-8, is an organic compound characterized by its aromatic structure and functional groups. It features a benzene ring substituted with a propynyl ether group and a hydroxymethyl group. The presence of the propynyl group introduces a triple bond, which can impart unique reactivity and properties, such as increased hydrophobicity and potential for further chemical modifications. The hydroxymethyl group contributes to the compound's polarity, enhancing its solubility in polar solvents. This compound may exhibit interesting biological activities due to its structural features, making it of interest in medicinal chemistry and materials science. Additionally, its synthesis and reactivity can be influenced by the presence of the alkyne, which can participate in various chemical reactions, including cycloadditions and coupling reactions. Overall, 3-(2-Propyn-1-yloxy)benzenemethanol is a versatile compound with potential applications in various fields, including pharmaceuticals and organic synthesis.

Formula: C₁₀H₁₀O₂

InChI: InChI=1S/C10H10O2/c1-2-6-12-10-5-3-4-9(7-10)8-11/h1,3-5,7,11H,6,8H2

InChI key: InChIKey=CJSZXTASUDBDKP-UHFFFAOYSA-N

SMILES: O(CC#C)C1=CC(CO)=CC=C1

Synonyms:

• 3-(2-Propyn-1-yloxy)benzenemethanol
• 3-(Propargyloxy)benzyl alcohol
• Benzenemethanol, 3-(2-propyn-1-yloxy)-
• [3-(Prop-2-yn-1-yloxy)phenyl]methanol
• Benzenemethanol, 3-(2-propynyloxy)-

[3-(Prop-2-yn-1-yloxy)phenyl]methanol

CAS: 34905-03-8

Versatile small molecule scaffold

Formula: C₁₀H₁₀O₂

Purity: Min. 95%

Molecular weight: 162.18 g/mol

Ref: 3D-JBA90503