CAS 34905-07-2
:(3-allyloxyphenyl)methanol
Description:
(3-Allyloxyphenyl)methanol is an organic compound characterized by its phenolic structure, which includes an allyloxy group attached to the aromatic ring. This compound features a hydroxymethyl group (-CH2OH) that contributes to its reactivity and potential applications in organic synthesis. The presence of the allyloxy group enhances its ability to participate in various chemical reactions, such as nucleophilic substitutions and polymerization processes. The compound is typically a colorless to pale yellow liquid or solid, depending on its purity and specific conditions. Its solubility in organic solvents makes it useful in various chemical applications, including as an intermediate in the synthesis of more complex molecules. Additionally, the presence of both the allyl and hydroxymethyl functionalities may impart unique properties, such as the ability to form hydrogen bonds or engage in cross-linking reactions, which can be advantageous in materials science and medicinal chemistry. Safety data should be consulted for handling and storage, as with any chemical substance.
Formula:C10H12O2
InChI:InChI=1/C10H12O2/c1-2-6-12-10-5-3-4-9(7-10)8-11/h2-5,7,11H,1,6,8H2
SMILES:C=CCOc1cccc(c1)CO
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 2 products.
[3-(Prop-2-en-1-yloxy)phenyl]methanol
CAS:<p>3-(Prop-2-en-1-yloxy)phenylmethanol is a multicomponent that inhibits the activity of β-amyloid peptides. It has been shown to inhibit the formation of amyloid fibrils in Alzheimer's disease, which may be due to its ability to bind to β-amyloid and inhibit their aggregation. 3-(Prop-2-en-1-yloxy)phenylmethanol has also been shown to have an inhibiting effect on the enzyme that forms amyloid fibrils, protein kinase C (PKC).</p>Formula:C10H12O2Purity:Min. 95%Molecular weight:164.2 g/mol

