CAS 349087-34-9
:(4-benzylpiperidin-1-yl)[2-methoxy-4-(methylsulfanyl)phenyl]methanone
Description:
(4-benzylpiperidin-1-yl)[2-methoxy-4-(methylsulfanyl)phenyl]methanone, with the CAS number 349087-34-9, is a synthetic organic compound characterized by its complex structure, which includes a piperidine ring, a benzyl group, and a methanone moiety. This compound features a methoxy group and a methylthio group on a phenyl ring, contributing to its unique chemical properties. The presence of the piperidine ring suggests potential pharmacological activity, as piperidine derivatives are often explored for their effects on the central nervous system. The methoxy and methylthio substituents can influence the compound's solubility, reactivity, and interaction with biological targets. Additionally, the compound's molecular structure may exhibit specific stereochemistry, which can affect its biological activity and binding affinity. Overall, this compound is of interest in medicinal chemistry and may have applications in drug development, particularly in the search for new therapeutic agents. However, detailed studies would be necessary to fully understand its properties and potential uses.
Formula:C21H25NO2S
InChI:InChI=1/C21H25NO2S/c1-24-20-15-18(25-2)8-9-19(20)21(23)22-12-10-17(11-13-22)14-16-6-4-3-5-7-16/h3-9,15,17H,10-14H2,1-2H3
SMILES:COc1cc(ccc1C(=O)N1CCC(CC1)Cc1ccccc1)SC
Synonyms:- Methanone, [2-methoxy-4-(methylthio)phenyl][4-(phenylmethyl)-1-piperidinyl]-
- (4-Benzylpiperidin-1-yl)[2-methoxy-4-(methylsulfanyl)phenyl]methanone
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 2 products.
p38 MAP Kinase Inhibitor VI, JX401
CAS:**p38 MAP Kinase Inhibitor VI, JX401** is a potent and selective small molecule inhibitor, which is synthesized through precise chemical processes involving advanced organic synthesis techniques. Featuring a high specificity for p38 MAP kinase, this inhibitor works by blocking the ATP-binding site of the kinase, thereby obstructing its catalytic activity. This inhibition impedes the downstream signaling pathways that are crucial for inflammatory responses, cell differentiation, and apoptosis, making it an invaluable tool in research contexts.Formula:C21H25NO2SPurity:Min. 95%Molecular weight:355.49 g/molJX 401
CAS:JX 401 is a p38α inhibitor.Formula:C21H25NO2SPurity:98%Color and Shape:SolidMolecular weight:355.49

