CAS 349120-91-8: 2-Bromo-N-(2,3-dichlorophenyl)acetamide

Description:2-Bromo-N-(2,3-dichlorophenyl)acetamide is a chemical compound characterized by its unique structure, which includes a bromine atom and a dichlorophenyl group attached to an acetamide moiety. This compound typically appears as a solid and is soluble in organic solvents, reflecting its moderate polarity. The presence of the bromine and chlorine atoms contributes to its reactivity and potential biological activity, making it of interest in medicinal chemistry and agrochemical applications. The compound's molecular structure suggests it may exhibit specific interactions with biological targets, potentially influencing its pharmacological properties. Additionally, the halogen substituents can enhance lipophilicity, affecting its absorption and distribution in biological systems. Safety data should be consulted, as halogenated compounds can pose environmental and health risks. Overall, 2-Bromo-N-(2,3-dichlorophenyl)acetamide represents a class of compounds that may have significant applications in research and industry, particularly in the development of new therapeutic agents.

Formula:C₈H₆BrCl₂NO

InChI:InChI=1S/C8H6BrCl2NO/c9-4-7(13)12-6-3-1-2-5(10)8(6)11/h1-3H,4H2,(H,12,13)

InChI key:InChIKey=YFSBEKSZGIWPPL-UHFFFAOYSA-N

SMILES:O=C(NC=1C=CC=C(Cl)C1Cl)CBr

Synonyms:
2-Bromo-N-(2,3-dichlorophenyl)acetamide
Acetamide, 2-bromo-N-(2,3-dichlorophenyl)-

Found 2 products.

Brand	Product data	Purity	Price range	Estimated delivery
	2-bromo-N-(2,3-dichlorophenyl)acetamide REF: 10-F368199CAS: 349120-91-8	- - -	- - -	Discontinued product
	2-Bromo-N-(2,3-dichlorophenyl)acetamide REF: 3D-FB120440CAS: 349120-91-8	Min. 95%	- - -	Discontinued product