CAS 34914-39-1
:Acetic acid, 2,2′,2′′-[methylidynetris(thio)]tris-
Description:
Acetic acid, 2,2′,2′′-[methylidynetris(thio)]tris- is a chemical compound characterized by its unique structure, which includes multiple thioether groups linked to a central acetic acid moiety. This compound is part of a class of thio compounds that exhibit interesting chemical properties due to the presence of sulfur atoms, which can influence reactivity and solubility. The thioether groups can enhance the compound's ability to participate in various chemical reactions, including nucleophilic substitutions and coordination with metal ions. Additionally, the presence of the acetic acid functional group suggests that the compound may exhibit acidic properties, allowing it to donate protons in solution. Its CAS number, 34914-39-1, is a unique identifier that facilitates the identification and study of this compound in scientific literature and databases. Overall, this compound's characteristics make it of interest in various fields, including organic synthesis and materials science, where its unique properties can be harnessed for specific applications.
Formula:C7H10O6S3
InChI:InChI=1S/C7H10O6S3/c8-4(9)1-14-7(15-2-5(10)11)16-3-6(12)13/h7H,1-3H2,(H,8,9)(H,10,11)(H,12,13)
InChI key:InChIKey=ZBNBQISDCFIEQC-UHFFFAOYSA-N
SMILES:C(SCC(O)=O)(SCC(O)=O)SCC(O)=O
Synonyms:- (Methylidynetrithio)triacetic acid
- 2,2',2''-(Methanetriyltrisulfanediyl)Triacetic Acid
- 2,2',2''-(Methylidynetris(thio))trisacetic acid
- 2,2′,2′′-[Methylidynetris(thio)]trisacetic acid
- Acetic acid, 2,2′,2′′-[methylidynetris(thio)]tris-
- Acetic acid, S,S′,S′′-methenyltris[mercapto-
- Ritiometan [INN]
- Ritiometanum
- Ritiometanum [Latin]
- Unii-J89Lm8Qvee
- Ritiometan
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Ritiometan
CAS:Controlled ProductStability Hygroscopic
Applications Ritiometan is an antibacterial that is used in nasal sprays.
References Mor, A., et al.: PCT, US 20110105386 A1 (2009);Formula:C7H10O6S3Color and Shape:White To Off-WhiteMolecular weight:286.35
