CAS 34916-70-6

4-Chloro-2,5,6-trimethylpyrimidine

Description:

4-Chloro-2,5,6-trimethylpyrimidine is a heterocyclic organic compound characterized by a pyrimidine ring substituted with three methyl groups and one chlorine atom. The presence of the chlorine atom at the 4-position and the three methyl groups at the 2, 5, and 6 positions contribute to its unique chemical properties. This compound is typically a colorless to pale yellow liquid or solid, depending on its physical state at room temperature. It is known for its role in various chemical syntheses and can serve as an intermediate in the production of pharmaceuticals and agrochemicals. The compound exhibits moderate solubility in organic solvents and is relatively stable under standard conditions. Its reactivity is influenced by the electron-withdrawing nature of the chlorine substituent, which can affect nucleophilic attack and other chemical reactions. Safety data indicates that, like many chlorinated compounds, it should be handled with care due to potential toxicity and environmental concerns.

Formula: C₇H₉ClN₂

InChI: InChI=1S/C7H9ClN2/c1-4-5(2)9-6(3)10-7(4)8/h1-3H3

InChI key: InChIKey=DIZOLBAICJZMSH-UHFFFAOYSA-N

SMILES: CC=1C(C)=NC(C)=NC1Cl

Synonyms:

• Pyrimidine, 4-chloro-2,5,6-trimethyl-
• 4-Chloro-2,5,6-trimethylpyrimidine

4-chloro-2,5,6-trimethylpyrimidine

CAS: 34916-70-6

Formula: C₇H₉ClN₂

Purity: 98%

Color and Shape: Liquid, No data available.

Molecular weight: 156.61

Ref: 10-F312910

4-Chloro-2,5,6-trimethylpyrimidine

CAS: 34916-70-6

Versatile small molecule scaffold

Formula: C₇H₉ClN₂

Purity: Min. 95%

Molecular weight: 156.61 g/mol

Ref: 3D-JBA91670