CAS 34921-76-1

N-(4-cyano-2-ethylphenyl)acetamide

Description:

N-(4-cyano-2-ethylphenyl)acetamide is an organic compound characterized by its amide functional group, which is derived from acetic acid and an aromatic amine. The presence of a cyano group (-CN) and an ethyl substituent on the phenyl ring contributes to its unique chemical properties. This compound typically exhibits moderate solubility in organic solvents, reflecting its aromatic nature, while being less soluble in water due to the hydrophobic characteristics of the phenyl and ethyl groups. The cyano group enhances the compound's reactivity, making it a potential candidate for various chemical reactions, including nucleophilic substitutions and coupling reactions. Additionally, the compound may display biological activity, which could be of interest in pharmaceutical research. Its molecular structure suggests potential applications in materials science and organic synthesis. Safety data should be consulted for handling and usage, as with any chemical substance, to ensure proper precautions are taken.

Formula: C₁₁H₁₂N₂O

InChI: InChI=1/C11H12N2O/c1-3-10-6-9(7-12)4-5-11(10)13-8(2)14/h4-6H,3H2,1-2H3,(H,13,14)

SMILES: CCc1cc(ccc1N=C(C)O)C#N

Synonyms:

• acetamide, N-(4-cyano-2-ethylphenyl)-
• N1-(4-Cyano-2-Ethylphenyl)Acetamide
• N-(4-Cyano-2-ethylphenyl)acetamide

4-Acetamido-3-ethylbenzonitrile

CAS: 34921-76-1

4-Acetamido-3-ethylbenzonitrile

Purity: ≥95%

Color and Shape: Solid

Molecular weight: 188.23g/mol

Ref: 54-OR6971