CAS 34924-96-4
:4-(2-Phenylethyl)-1-piperazinamine
Description:
4-(2-Phenylethyl)-1-piperazinamine, identified by its CAS number 34924-96-4, is a chemical compound that features a piperazine ring substituted with a phenylethyl group. This compound is characterized by its amine functional group, which contributes to its potential as a pharmacological agent. The presence of the piperazine moiety often indicates possible interactions with neurotransmitter systems, making it of interest in medicinal chemistry, particularly in the development of psychoactive drugs. The phenylethyl substituent can enhance lipophilicity, potentially affecting the compound's bioavailability and ability to cross biological membranes. Additionally, the structural configuration may influence its binding affinity to various receptors, which is crucial for its therapeutic applications. As with many amines, it may exhibit basic properties, allowing it to form salts with acids. Overall, 4-(2-Phenylethyl)-1-piperazinamine represents a compound with significant potential for research in pharmacology and medicinal chemistry, although specific biological activities and safety profiles would require further investigation.
Formula:C12H19N3
InChI:InChI=1S/C12H19N3/c13-15-10-8-14(9-11-15)7-6-12-4-2-1-3-5-12/h1-5H,6-11,13H2
InChI key:InChIKey=KAHOOFLESLALQF-UHFFFAOYSA-N
SMILES:C(CC1=CC=CC=C1)N2CCN(N)CC2
Synonyms:- 1-Piperazinamine, 4-(2-phenylethyl)-
- 4-(2-Phenylethyl)-1-piperazinamine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.

