CAS 3493-11-6

L-methionine-S-methylsulfonium iodine

Description:

L-methionine-S-methylsulfonium iodine, with the CAS number 3493-11-6, is a quaternary ammonium compound derived from the amino acid L-methionine. It features a sulfonium group, which contributes to its unique properties. This compound is typically characterized by its stability and solubility in water, making it useful in various biochemical applications. L-methionine itself is an essential amino acid, playing a crucial role in protein synthesis and serving as a precursor for other important biomolecules. The presence of the methylsulfonium group enhances its reactivity, particularly in biological systems, where it can participate in methylation reactions. Additionally, the iodine component may impart antimicrobial properties, making this compound of interest in pharmaceutical and nutritional contexts. Overall, L-methionine-S-methylsulfonium iodine is notable for its biological significance and potential applications in health and nutrition.

Formula: C₆H₁₆INO₂S₂

InChI: InChI=1/C5H11NO2S.CH4S.HI/c1-9-3-2-4(6)5(7)8;1-2;/h4H,2-3,6H2,1H3,(H,7,8);2H,1H3;1H/t4-;;/m0../s1

SMILES: CSCC[C@@H](C(=O)O)N.CS.I

Synonyms:

• Sulfonium, (3-amino-3-carboxypropyl)dimethyl-, iodide, (S)-
• (S)-(3-Amino-3-carboxypropyl)dimethylsulfonium iodide

S-Methyl-L-Methionine Iodide

CAS: 3493-11-6

Formula: C₆H₁₄NO₂S·I

Color and Shape: White To Off-White Solid

Molecular weight: 164.24 126.91

Ref: 4Z-M-4715