CymitQuimica logo

CAS 349401-48-5

:

ethyl (4-benzylpiperazin-1-yl)(oxo)acetate

Description:
Ethyl (4-benzylpiperazin-1-yl)(oxo)acetate, with the CAS number 349401-48-5, is a chemical compound characterized by its unique structure that includes a piperazine ring substituted with a benzyl group and an ester functional group. This compound typically exhibits properties associated with both piperazine derivatives and esters, such as moderate solubility in organic solvents and potential bioactivity due to the presence of the piperazine moiety, which is often linked to pharmacological effects. The oxoacetate functional group suggests the presence of a carbonyl, which can participate in various chemical reactions, including nucleophilic attacks. Ethyl (4-benzylpiperazin-1-yl)(oxo)acetate may be of interest in medicinal chemistry for its potential therapeutic applications, particularly in the development of new pharmaceuticals. Its synthesis and characterization would involve standard organic chemistry techniques, and its stability and reactivity would depend on the specific conditions under which it is handled. Overall, this compound represents a blend of structural features that could lead to diverse chemical behavior and applications.
Formula:C15H20N2O3
InChI:InChI=1/C15H20N2O3/c1-2-20-15(19)14(18)17-10-8-16(9-11-17)12-13-6-4-3-5-7-13/h3-7H,2,8-12H2,1H3
SMILES:CCOC(=O)C(=O)N1CCN(CC1)Cc1ccccc1
Synonyms:
  • 1-Piperazineacetic acid, alpha-oxo-4-(phenylmethyl)-, ethyl ester
  • Ethyl (4-benzylpiperazin-1-yl)(oxo)acetate
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.