CAS 34950-82-8

7-bromo-3,4-dihydro-2H-pyrido[3,2-b][1,4]oxazine

Description:

7-Bromo-3,4-dihydro-2H-pyrido[3,2-b][1,4]oxazine is a heterocyclic organic compound characterized by its unique bicyclic structure, which incorporates both a pyridine and an oxazine ring. The presence of a bromine atom at the 7-position contributes to its reactivity and potential applications in various chemical reactions. This compound typically exhibits properties associated with nitrogen-containing heterocycles, such as moderate solubility in polar solvents and potential biological activity. Its structure suggests that it may participate in nucleophilic substitution reactions due to the electron-withdrawing nature of the bromine atom. Additionally, the dihydro configuration indicates that it may exist in a stable, saturated form, which can influence its chemical behavior and stability. The compound's CAS number, 34950-82-8, allows for easy identification in chemical databases, facilitating research and application in fields such as medicinal chemistry and materials science. Overall, 7-bromo-3,4-dihydro-2H-pyrido[3,2-b][1,4]oxazine is of interest for its structural features and potential utility in synthetic chemistry.

Formula: C₇H₇BrN₂O

InChI: InChI=1/C7H7BrN2O/c8-5-3-6-7(10-4-5)9-1-2-11-6/h3-4H,1-2H2,(H,9,10)

SMILES: C1COc2cc(cnc2N1)Br

Synonyms:

• 2H-Pyrido[3,2-b]-1,4-oxazine, 7-bromo-3,4-dihydro-

7-Bromo-3,4-dihydro-2H-pyrido[3,2-b][1,4]oxazine

CAS: 34950-82-8

Formula: C₇H₇BrN₂O

Purity: 97%

Color and Shape: Solid

Molecular weight: 215.0473

Ref: IN-DA003NDO

7-Bromo-3,4-dihydro-2H-pyrido[3,2-b][1,4]oxazine

CAS: 34950-82-8

7-Bromo-3,4-dihydro-2H-pyrido[3,2-b][1,4]oxazine

Purity: 97%

Molecular weight: 215.05g/mol

Ref: 54-OR91822

7-Bromo-3,4-dihydro-2H-pyrido[3,2-b][1,4]oxazine

CAS: 34950-82-8

Formula: C₇H₇BrN₂O

Purity: 97%

Color and Shape: Solid

Molecular weight: 215.05

Ref: 10-F067658