CymitQuimica logo

CAS 34953-87-2

:

4-Pyrimidinemethanol,2-chloro-

Description:
4-Pyrimidinemethanol, 2-chloro- is a chemical compound characterized by its pyrimidine ring structure, which is a six-membered aromatic heterocycle containing two nitrogen atoms at positions 1 and 3. This compound features a hydroxymethyl group (-CH2OH) attached to the pyrimidine ring at the 4-position and a chlorine atom at the 2-position, contributing to its reactivity and potential applications in various chemical reactions. The presence of the hydroxymethyl group suggests that it can participate in hydrogen bonding, influencing its solubility and interaction with other molecules. The chlorine substituent can enhance the compound's electrophilic character, making it useful in synthetic organic chemistry. 4-Pyrimidinemethanol, 2-chloro- may be of interest in pharmaceutical research and development due to its structural features, which can be modified to create derivatives with specific biological activities. As with many chemical substances, safety and handling precautions should be observed, given the potential hazards associated with chlorine-containing compounds.
Formula:C5H5ClN2O
InChI:InChI=1S/C5H5ClN2O/c6-5-7-2-1-4(3-9)8-5/h1-2,9H,3H2
InChI key:POXLTMBMLWQOQG-UHFFFAOYSA-N
SMILES:C1=CN=C(N=C1CO)Cl
Synonyms:
  • 4-Pyrimidinemethanol, 2-chloro- (9CI)
Found 5 products.