CAS 349534-98-1
:1′-Methyl[1,4′-bipiperidine]-4-carboxylic acid
Description:
1′-Methyl[1,4′-bipiperidine]-4-carboxylic acid is a chemical compound characterized by its bipiperidine structure, which consists of two interconnected piperidine rings with a methyl group and a carboxylic acid functional group. This compound typically exhibits properties associated with both amines and carboxylic acids, such as basicity due to the nitrogen atoms in the piperidine rings and acidity from the carboxylic group. It is likely to be a solid at room temperature, with potential solubility in polar solvents due to the presence of the carboxylic acid. The compound may be of interest in medicinal chemistry and drug development, given the structural motifs that are often associated with biological activity. Its unique structure could influence its pharmacokinetic properties, including absorption, distribution, metabolism, and excretion. Additionally, the presence of the methyl group may affect its steric and electronic properties, potentially enhancing its interaction with biological targets. As with any chemical substance, safety and handling precautions should be observed, particularly in laboratory settings.
Formula:C12H22N2O2
InChI:InChI=1S/C12H22N2O2/c1-13-6-4-11(5-7-13)14-8-2-10(3-9-14)12(15)16/h10-11H,2-9H2,1H3,(H,15,16)
InChI key:InChIKey=MVVCBMNRXWHOBD-UHFFFAOYSA-N
SMILES:C(O)(=O)C1CCN(CC1)C2CCN(C)CC2
Synonyms:- 1′-Methyl[1,4′-bipiperidine]-4-carboxylic acid
- 1′-Methyl-1,4′-bipiperidine-4-carboxylic acid
- [1,4′-Bipiperidine]-4-carboxylic acid, 1′-methyl-
- 1′-Methyl-[1,4′]bipiperidinyl-4-carboxylic acid
- 1-(1-Methylpiperidin-4-yl)piperidine-4-carboxylic acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.