CymitQuimica logo

CAS 349550-81-8

:

2,3-dihydro-1,4-benzodioxine-5-carboxamide

Description:
2,3-Dihydro-1,4-benzodioxine-5-carboxamide is a chemical compound characterized by its unique bicyclic structure, which includes a benzodioxine moiety. This compound features a carboxamide functional group, contributing to its potential reactivity and solubility properties. Typically, compounds of this nature exhibit moderate polarity due to the presence of both aromatic and polar functional groups, which can influence their interactions in biological systems. The bicyclic structure may also impart specific conformational characteristics that can affect its biological activity and pharmacokinetics. While specific physical properties such as melting point, boiling point, and solubility can vary, compounds with similar structures often show potential for use in medicinal chemistry, particularly in the development of pharmaceuticals. The presence of the carboxamide group may enhance hydrogen bonding capabilities, potentially increasing the compound's affinity for biological targets. As with many organic compounds, safety and handling precautions should be observed, particularly in laboratory settings, due to potential toxicity or reactivity.
Formula:C9H9NO3
InChI:InChI=1/C9H9NO3/c10-9(11)6-2-1-3-7-8(6)13-5-4-12-7/h1-3H,4-5H2,(H2,10,11)
InChI key:OIYLTYTXMKZKCR-UHFFFAOYSA-N
SMILES:c1cc(c2c(c1)OCCO2)C(=N)O
Found 4 products.