CAS 349553-98-6

2H-Pyran-2-one-5,6-d2, tetrahydro-5,6-d2-4-hydroxy-4-methyl-

Description:

2H-Pyran-2-one-5,6-d2, tetrahydro-5,6-d2-4-hydroxy-4-methyl- is a chemical compound characterized by its pyranone structure, which features a six-membered ring containing both oxygen and carbon atoms. The presence of deuterium (d2) indicates that this compound has two hydrogen atoms replaced by deuterium isotopes, which can influence its physical and chemical properties, such as stability and reactivity. The tetrahydro configuration suggests that the compound has a saturated ring system, contributing to its overall stability. The hydroxy (-OH) and methyl (-CH3) functional groups attached to the ring enhance its reactivity and solubility in polar solvents. This compound may be of interest in various fields, including organic synthesis and medicinal chemistry, due to its potential biological activity and utility as a building block in the synthesis of more complex molecules. Its specific properties, such as melting point, boiling point, and solubility, would depend on the molecular interactions and the presence of functional groups.

Formula: C₆H₆D₄O₃

InChI: InChI=1S/C6H10O3/c1-6(8)2-3-9-5(7)4-6/h8H,2-4H2,1H3/i2D2,3D2

InChI key: InChIKey=JYVXNLLUYHCIIH-RRVWJQJTSA-N

SMILES: CC1(O)CC(=O)OC(C1([2H])[2H])([2H])[2H]

Synonyms:

• 2H-Pyran-2-one-5,6-d2, tetrahydro-5,6-d2-4-hydroxy-4-methyl-

(+/-)-Mevalonolactone-4,4,5,5-d4

CAS: 349553-98-6

Purity: 98 atom % D

Color and Shape: Colorless Liquid - White Solid

Molecular weight: 134.17

Ref: 3U-D4130

(±)-Mevalonolactone-4,4,5,5-d4

Controlled Product

CAS: 349553-98-6

Stability Hygroscopic
Applications (±)-Mevalonolactone-4,4,5,5-d4 (CAS# 349553-98-6) is a useful isotopically labeled research compound.

Formula: C₆D₄H₆O₃

Color and Shape: Neat

Molecular weight: 134.17

Ref: TR-D339027