CAS 34961-64-3
:3-(4-formylphenyl)propanoic acid
Description:
3-(4-Formylphenyl)propanoic acid, with the CAS number 34961-64-3, is an organic compound characterized by its structure, which includes a propanoic acid moiety attached to a phenyl group that has a formyl substituent at the para position. This compound typically appears as a solid at room temperature and is soluble in polar solvents due to the presence of the carboxylic acid functional group. It exhibits both acidic and aromatic properties, making it useful in various chemical reactions, including condensation and esterification. The presence of the aldehyde group (formyl) allows for further functionalization, enabling its application in organic synthesis and material science. Additionally, it may exhibit biological activity, which can be explored for potential pharmaceutical applications. Its reactivity and functional groups make it a versatile intermediate in the synthesis of more complex organic molecules. Safety data should be consulted for handling, as with all chemical substances, to ensure proper precautions are taken.
Formula:C10H10O3
InChI:InChI=1/C10H10O3/c11-7-9-3-1-8(2-4-9)5-6-10(12)13/h1-4,7H,5-6H2,(H,12,13)
SMILES:c1cc(ccc1CCC(=O)O)C=O
Synonyms:- Benzenepropanoic Acid, 4-Formyl-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
3-(4-Formylphenyl)propionic acid, 96%
CAS:3-(4-Formylphenyl)propionic acid is used as an intermediate in the manufacture of pharmaceuticals. This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar
Formula:C10H10O3Purity:96%Color and Shape:Pale cream to cream, Crystals or powder or crystalline powderMolecular weight:178.193-(4-Formylphenyl)propanoic acid
CAS:Formula:C10H10O3Purity:95%Color and Shape:SolidMolecular weight:178.18463-(4-Formylphenyl)propanoic acid
CAS:3-(4-Formylphenyl)propanoic acidPurity:95%Molecular weight:178.19g/mol3-(4-Formylphenyl)propanoic acid
CAS:Formula:C10H10O3Purity:96%Color and Shape:SolidMolecular weight:178.187



