CymitQuimica logo

CAS 349619-73-4

:

N-(2-bromophenyl)-4-chloro-3-nitrobenzamide

Description:
N-(2-bromophenyl)-4-chloro-3-nitrobenzamide is an organic compound characterized by its complex aromatic structure, which includes a benzamide moiety substituted with a bromine atom, a chlorine atom, and a nitro group. The presence of these substituents contributes to its unique chemical properties, such as increased reactivity and potential for various interactions in biological systems. The bromine and chlorine atoms are halogens, which can influence the compound's polarity and solubility in different solvents. The nitro group is known for its electron-withdrawing properties, which can affect the compound's reactivity in electrophilic aromatic substitution reactions. This compound may exhibit biological activity, making it of interest in medicinal chemistry and drug development. Its specific applications and behavior in chemical reactions would depend on the context of its use, including potential interactions with biological targets or its role in synthetic pathways. Overall, N-(2-bromophenyl)-4-chloro-3-nitrobenzamide represents a versatile structure in organic chemistry with implications in various fields.
Formula:C13H8BrClN2O3
InChI:InChI=1/C13H8BrClN2O3/c14-9-3-1-2-4-11(9)16-13(18)8-5-6-10(15)12(7-8)17(19)20/h1-7H,(H,16,18)
SMILES:c1ccc(c(c1)Br)N=C(c1ccc(c(c1)N(=O)=O)Cl)O
Synonyms:
  • benzamide, N-(2-bromophenyl)-4-chloro-3-nitro-
Found 1 products.