CAS 34966-52-4

ethyl 2-(3,4-dichlorophenyl)-2-oxoacetate

Description:

Ethyl 2-(3,4-dichlorophenyl)-2-oxoacetate, with the CAS number 34966-52-4, is an organic compound characterized by its ester functional group and a dichlorophenyl substituent. This compound features a carbonyl group adjacent to an ethyl ester, which contributes to its reactivity and potential applications in organic synthesis. The presence of the 3,4-dichlorophenyl group indicates that it has two chlorine atoms substituted on the aromatic ring, which can influence its electronic properties and biological activity. Ethyl 2-(3,4-dichlorophenyl)-2-oxoacetate is typically a colorless to pale yellow liquid or solid, depending on its purity and form. It is soluble in organic solvents, making it useful in various chemical reactions, including acylation and esterification processes. Additionally, due to its structural features, this compound may exhibit interesting pharmacological properties, making it a subject of interest in medicinal chemistry. Safety data should be consulted for handling and storage, as with all chemical substances.

Formula: C₁₀H₈Cl₂O₃

InChI: InChI=1/C10H8Cl2O3/c1-2-15-10(14)9(13)6-3-4-7(11)8(12)5-6/h3-5H,2H2,1H3

SMILES: CCOC(=O)C(=O)c1ccc(c(c1)Cl)Cl

Synonyms:

• Ethyl (3,4-Dichlorophenyl)(Oxo)Acetate

Ethyl 3,4-Dichlorobenzoylformate

CAS: 34966-52-4

Formula: C₁₀H₈Cl₂O₃

Purity: 97%

Color and Shape: Liquid

Molecular weight: 247.0747

Ref: IN-DA00C0OI

Ethyl (3,4-dichlorophenyl)(oxo)acetate

CAS: 34966-52-4

Ethyl (3,4-dichlorophenyl)(oxo)acetate

Purity: 97%

Color and Shape: Yellow Liquid

Molecular weight: 247.07g/mol

Ref: 54-OR0096

Ethyl 3,4-dichlorobenzoylformate

CAS: 34966-52-4

Formula: C₁₀H₈Cl₂O₃

Purity: 97%+(GC-MS);RG

Color and Shape: Liquid, Clear

Molecular weight: 247.07

Ref: 10-F023002