CAS 34970-18-8

3,3-Dimethylcyclobutanecarboxylic acid

Description:

3,3-Dimethylcyclobutanecarboxylic acid is a cyclic carboxylic acid characterized by a cyclobutane ring with two methyl groups attached to the same carbon atom, specifically at the 3-position, and a carboxylic acid functional group at the 1-position. This compound has a molecular formula that reflects its cyclic structure and substituents, contributing to its unique properties. It is typically a colorless liquid or solid at room temperature, exhibiting moderate solubility in polar solvents due to the presence of the carboxylic acid group. The presence of the bulky dimethyl groups can influence its reactivity and steric hindrance, affecting its interactions with other molecules. 3,3-Dimethylcyclobutanecarboxylic acid may participate in various chemical reactions typical of carboxylic acids, such as esterification and decarboxylation. Its specific applications and behavior in chemical reactions can vary, but it is of interest in organic synthesis and potentially in the development of pharmaceuticals or agrochemicals. As with all chemical substances, proper handling and safety precautions should be observed.

Formula: C₇H₁₂O₂

InChI: InChI=1S/C7H12O2/c1-7(2)3-5(4-7)6(8)9/h5H,3-4H2,1-2H3,(H,8,9)

InChI key: InChIKey=UWOAWSLEKWLDNR-UHFFFAOYSA-N

SMILES: C(O)(=O)C1CC(C)(C)C1

Synonyms:

• 3,3-Dimethylcyclobutane-1-Carboxylic Acid
• Cyclobutanecarboxylic acid, 3,3-dimethyl-
• 3,3-Dimethylcyclobutanecarboxylic acid

3,3-Dimethylcyclobutanecarboxylic acid

CAS: 34970-18-8

Formula: C₇H₁₂O₂

Purity: 97%

Color and Shape: Liquid

Molecular weight: 128.1690

Ref: IN-DA00381P

3,3-Dimethylcyclobutanecarboxylic acid

CAS: 34970-18-8

3,3-Dimethylcyclobutanecarboxylic acid

Formula: C₇H₁₂O₂

Purity: 97%

Color and Shape: colourless liquid

Molecular weight: 128.17g/mol

Ref: 54-OR317125

3,3-Dimethylcyclobutanecarboxylic acid

CAS: 34970-18-8

Formula: C₇H₁₂O₂

Purity: 95.0%

Color and Shape: Liquid

Molecular weight: 128.171

Ref: 10-F233988