CAS 34971-74-9

3-(1-Methylethyl)-1-pyrrolidineethanamine

Description:

3-(1-Methylethyl)-1-pyrrolidineethanamine, also known by its CAS number 34971-74-9, is a chemical compound that belongs to the class of amines. It features a pyrrolidine ring, which is a five-membered nitrogen-containing heterocycle, and an ethylamine side chain. This compound is characterized by its potential biological activity, often studied in the context of pharmacology and medicinal chemistry. The presence of the isopropyl group (1-methylethyl) contributes to its steric properties, which can influence its interaction with biological targets. The compound may exhibit various physical properties such as solubility in organic solvents and potential volatility, depending on its molecular structure. Its amine functional group can participate in hydrogen bonding, affecting its reactivity and interactions with other molecules. As with many amines, it may also exhibit basicity, allowing it to act as a proton acceptor in chemical reactions. Overall, 3-(1-Methylethyl)-1-pyrrolidineethanamine is of interest in research for its potential applications in drug development and synthesis.

Formula: C₉H₂₀N₂

InChI: InChI=1S/C9H20N2/c1-8(2)9-3-5-11(7-9)6-4-10/h8-9H,3-7,10H2,1-2H3

InChI key: InChIKey=FDLHDWOXBFKAND-UHFFFAOYSA-N

SMILES: C(C)(C)C1CN(CCN)CC1

Synonyms:

• 2-[3-(Propan-2-yl)pyrrolidin-1-yl]ethan-1-amine
• 3-(1-Methylethyl)-1-pyrrolidineethanamine
• 1-Pyrrolidineethanamine, 3-(1-methylethyl)-

2-[3-(Propan-2-yl)pyrrolidin-1-yl]ethan-1-amine

CAS: 34971-74-9

Versatile small molecule scaffold

Formula: C₉H₂₀N₂

Purity: Min. 95%

Molecular weight: 156.27 g/mol

Ref: 3D-JBA97174