CAS 34981-25-4
:Kuraridin
Description:
Kuraridin, with the CAS number 34981-25-4, is a chemical compound that is primarily known for its presence in certain plant species, particularly those in the family Menispermaceae. It is classified as an alkaloid, which are naturally occurring compounds that often exhibit pharmacological properties. Kuraridin is characterized by its complex molecular structure, which contributes to its biological activity. This compound has been studied for its potential effects on the nervous system, particularly in relation to muscle relaxation and analgesic properties. Additionally, kuraridin may exhibit interactions with various neurotransmitter systems, although detailed mechanisms of action require further investigation. Its solubility, stability, and reactivity can vary depending on environmental conditions and the presence of other substances. As with many alkaloids, kuraridin's safety profile and potential therapeutic applications are subjects of ongoing research, highlighting the importance of understanding its pharmacokinetics and toxicology in both medicinal and ecological contexts.
Formula:C26H30O6
InChI:InChI=1S/C26H30O6/c1-15(2)6-7-18(16(3)4)12-20-23(30)14-24(32-5)25(26(20)31)21(28)11-9-17-8-10-19(27)13-22(17)29/h6,8-11,13-14,18,27,29-31H,3,7,12H2,1-2,4-5H3/b11-9+/t18-/m1/s1
InChI key:InChIKey=PIAPWPAWQGDOMN-SXAWMYDMSA-N
SMILES:C(/C=C/C1=C(O)C=C(O)C=C1)(=O)C2=C(OC)C=C(O)C(C[C@@H](CC=C(C)C)C(C)=C)=C2O
Synonyms:- 2-Propen-1-one, 1-[2,4-dihydroxy-6-methoxy-3-[(2R)-5-methyl-2-(1-methylethenyl)-4-hexenyl]phenyl]-3-(2,4-dihydroxyphenyl)-, (2E)-
- 2-Propen-1-one, 1-[2,4-dihydroxy-6-methoxy-3-[5-methyl-2-(1-methylethenyl)-4-hexenyl]phenyl]-3-(2,4-dihydroxyphenyl)-, (E)-(+)-
- Kuraridin
- 2-Propen-1-one, 1-[2,4-dihydroxy-6-methoxy-3-[(2R)-5-methyl-2-(1-methylethenyl)-4-hexen-1-yl]phenyl]-3-(2,4-dihydroxyphenyl)-, (2E)-
- (2E)-1-[2,4-Dihydroxy-6-methoxy-3-[(2R)-5-methyl-2-(1-methylethenyl)-4-hexen-1-yl]phenyl]-3-(2,4-dihydroxyphenyl)-2-propen-1-one
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 2 products.
Kuraridine
CAS:Kuraridine is measured against cGMP PDE5 to identify potent cGMP specific phosphodiesterase type 5 inhibitory constituents.Formula:C26H30O6Purity:98%Color and Shape:SolidMolecular weight:438.51Kuraridine
CAS:Kuraridine is a peptide that is used as a research tool to study the interaction between proteins. Kuraridine has been shown to inhibit ion channels, such as sodium and potassium channels, and can be used to regulate the activity of cells. Kuraridine has been shown to bind with receptors on cells and inhibit protein interactions. It is an inhibitor of peptidases and other enzymes that are involved in protein degradation. Kuraridine binds to ligands or receptors on cells, altering their function by disrupting protein interactions or inhibiting ion channel activity.
Formula:C26H30O6Purity:Min. 95%Molecular weight:438.5 g/mol

