CAS 350-28-7
:3-Fluoro-4-methylbenzoic acid
Description:
3-Fluoro-4-methylbenzoic acid, with the CAS number 350-28-7, is an aromatic carboxylic acid characterized by the presence of a fluorine atom and a methyl group on a benzoic acid framework. The fluorine atom is located at the meta position relative to the carboxylic acid group, while the methyl group is situated at the para position. This compound typically appears as a white to off-white solid and is known for its moderate solubility in organic solvents and limited solubility in water. It exhibits acidic properties due to the carboxylic acid functional group, allowing it to participate in various chemical reactions, including esterification and amidation. The presence of the fluorine atom can influence the compound's reactivity and polarity, making it useful in synthetic organic chemistry and pharmaceuticals. Additionally, 3-fluoro-4-methylbenzoic acid can serve as an intermediate in the synthesis of more complex molecules, contributing to its significance in chemical research and industrial applications.
Formula:C8H7FO2
InChI:InChI=1S/C8H7FO2/c1-5-2-3-6(8(10)11)4-7(5)9/h2-4H,1H3,(H,10,11)
InChI key:InChIKey=XUQCONCMPCVUDM-UHFFFAOYSA-N
SMILES:C(O)(=O)C1=CC(F)=C(C)C=C1
Synonyms:- 3-Fluoro-4-Methylbenzoate
- 3-Fluoro-4-toluic acid
- 3-Fluoro-p-toluic acid
- 3-Fluoro-p-toluic acid (COOH=1)
- 5-Fluoro-4-methylbenzoic acid
- Benzoic acid, 3-fluoro-4-methyl-
- NSC 56683
- p-Toluic acid, 3-fluoro-
- 3-Fluoro-4-methylbenzoic acid
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
3-Fluoro-4-methylbenzoic acid
CAS:Formula:C8H7FO2Purity:96%Color and Shape:SolidMolecular weight:154.13843-Fluoro-4-methylbenzoic acid
CAS:3-Fluoro-4-methylbenzoic acidFormula:C8H7FO2Purity:97%Color and Shape: off-white crystalline powderMolecular weight:154.14g/mol3-Fluoro-4-methylbenzoic Acid
CAS:Formula:C8H7FO2Purity:>98.0%(GC)(T)Color and Shape:White to Light yellow powder to crystalMolecular weight:154.143-Fluoro-4-methylbenzoic acid
CAS:3-Fluoro-4-methylbenzoic acid is an organic compound that is used as a ligand in coordination chemistry. This compound is an alkynyl ligand with a selenium atom at the 3 position, and it can be used to make metal complexes with cycloalkyl and heterocycloalkyl rings. 3-Fluoro-4-methylbenzoic acid has been shown to be a potent inhibitor of matrix metalloproteinase activity.
Formula:C8H7FO2Purity:Min. 95%Color and Shape:PowderMolecular weight:154.14 g/mol3-Fluoro-4-methylbenzoic acid
CAS:Formula:C8H7FO2Purity:96%Color and Shape:SolidMolecular weight:154.14





