CAS 350-51-6
:3-Fluorostyrene
Description:
3-Fluorostyrene is an organic compound characterized by the presence of a fluorine atom attached to the aromatic ring of styrene. It has a molecular formula of C8H7F and features a vinyl group (–CH=CH2) directly bonded to a phenyl group (C6H5). This compound is typically a colorless to pale yellow liquid with a characteristic aromatic odor. It is known for its reactivity, particularly in polymerization reactions, where it can be used as a monomer to produce various copolymers. The presence of the fluorine atom enhances its chemical properties, such as increasing the electron-withdrawing capacity of the aromatic ring, which can influence its reactivity and stability. 3-Fluorostyrene is utilized in the synthesis of specialty chemicals and materials, and it may also exhibit unique physical properties, such as solubility in organic solvents. Safety precautions should be observed when handling this compound, as it may pose health risks if inhaled or ingested.
Formula:C8H7F
InChI:InChI=1S/C8H7F/c1-2-7-4-3-5-8(9)6-7/h2-6H,1H2
InChI key:InChIKey=ZJSKEGAHBAHFON-UHFFFAOYSA-N
SMILES:C(=C)C1=CC(F)=CC=C1
Synonyms:- 1-Ethenyl-3-Fluorobenzene
- 1-Fluoro-3-vinylbenzene
- 5-Fluorostyrene
- Benzene, 1-ethenyl-3-fluoro-
- Styrene, m-fluoro-
- m-Fluorostyrene
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
3-Fluorostyrene (stabilized with TBC)
CAS:Formula:C8H7FPurity:>97.0%(GC)Color and Shape:Colorless to Almost colorless clear liquidMolecular weight:122.143-Fluorostyrene
CAS:3-FluorostyreneFormula:C8H7FPurity:98%Color and Shape: colourless liquidMolecular weight:122.14g/mol1-Fluoro-3-vinylbenzene
CAS:Formula:C8H7FPurity:98% (stabilized with TBC)Color and Shape:Liquid, ClearMolecular weight:122.1423-Fluorostyrene
CAS:3-Fluorostyrene is a functional compound that has been used in flow system studies of the isomerization of 2-fluorostyrene. The reaction between 3-fluorostyrene and 2-fluorostyrene led to a synergic effect on the production of 1,3-dimethylcyclohexane, with the yield being greater than when only one reactant was used. 3-Fluorostyrene is also a molecule with fluorine and carbon atoms. It can be ionized by various techniques including electron capture detection, which provides information about its structure. Magnetic resonance spectroscopy can be used to study its vibrational modes and frequency shifts.
Formula:C8H7FPurity:Min. 95%Color and Shape:Clear LiquidMolecular weight:122.14 g/molRef: 3D-FF77096
Discontinued product




