CAS 350-67-4
:3-5-dichlorophenyl diazonium tetrafluoro borate
Description:
3,5-Dichlorophenyl diazonium tetrafluoroborate is a chemical compound characterized by its diazonium functional group, which is known for its reactivity and utility in organic synthesis, particularly in electrophilic aromatic substitution reactions. The presence of the tetrafluoroborate anion contributes to its stability and solubility in polar solvents. This compound typically appears as a crystalline solid and is sensitive to heat and light, which can lead to decomposition. The dichlorophenyl moiety indicates the presence of chlorine substituents at the 3 and 5 positions on the phenyl ring, influencing its electronic properties and reactivity. As a diazonium salt, it can be used in various applications, including the synthesis of azo dyes and other aromatic compounds. However, due to its potential hazards, including toxicity and the ability to form explosive compounds under certain conditions, it must be handled with care in a controlled laboratory environment. Proper safety protocols should be followed when working with this substance.
Formula:C6H3BCl2F4N2
InChI:InChI=1/C6H3Cl2N2.BF4/c7-4-1-5(8)3-6(2-4)10-9;2-1(3,4)5/h1-3H;/q+1;-1
Synonyms:- 3,5-Dichlorophenyldiazonium tetrafluoroborate
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
3,5-Dichlorobenzenediazonium tetrafluoroborate
CAS:Formula:C6H3BCl2F4N2Purity:98%Color and Shape:SolidMolecular weight:260.81203,5-Dichlorobenzenediazonium tetrafluoroborate
CAS:3,5-Dichlorobenzenediazonium tetrafluoroboratePurity:98%Molecular weight:260.81g/mol3,5-Dichlorophenyldiazonium Tetrafluroborate pure, 98%
CAS:Formula:C6H3Cl2N2·BF4Molecular weight:260.813,5-Dichlorophenyldiazonium Tetrafluoroborate
CAS:Controlled ProductFormula:C6H3Cl2N2•BF4Color and Shape:Light Orange Colour To OrangeMolecular weight:260.813,5-Dichlorophenyldiazonium tetrafluoroborate
CAS:3,5-Dichlorophenyldiazonium tetrafluoroborate (3,5-DCP) is a fine chemical that can be used as a building block in the synthesis of other compounds. 3,5-DCP is also used for research and reagents. It has a variety of uses as an intermediate and scaffold for more complex molecules. 3,5-Dichlorophenyldiazonium tetrafluoroborate is not toxic to humans and it is soluble in water. It can react with a wide range of organic compounds at room temperature to give some useful products such as alcohols, amines, nitriles, carboxylic acids or esters.
Formula:C6H3BCl2F4N2Purity:Min. 95%Molecular weight:260.81 g/mol






