CAS 350017-04-8

2-[(4-fluorophenyl)methyl]pyrrolidine

Description:

2-[(4-Fluorophenyl)methyl]pyrrolidine is an organic compound characterized by its pyrrolidine ring, which is a five-membered saturated nitrogen-containing heterocycle. The presence of a 4-fluorobenzyl group attached to the nitrogen atom of the pyrrolidine contributes to its unique properties. This compound typically exhibits moderate polarity due to the fluorine substituent, which can influence its reactivity and interaction with biological systems. It may possess potential pharmacological activities, making it of interest in medicinal chemistry. The fluorine atom can enhance lipophilicity and metabolic stability, potentially affecting the compound's bioavailability and pharmacokinetics. Additionally, the structural features of 2-[(4-fluorophenyl)methyl]pyrrolidine may allow for various synthetic modifications, enabling the exploration of its derivatives for diverse applications. As with many organic compounds, its physical properties, such as melting point, boiling point, and solubility, would depend on the specific conditions and purity of the sample. Overall, this compound represents a valuable structure for further research in chemical and pharmaceutical contexts.

Formula: C₁₁H₁₄FN

InChI: InChI=1/C11H14FN/c12-10-5-3-9(4-6-10)8-11-2-1-7-13-11/h3-6,11,13H,1-2,7-8H2

SMILES: C1CC(Cc2ccc(cc2)F)NC1

2-(4-Fluoro-benzyl)-pyrrolidine

CAS: 350017-04-8

Formula: C₁₁H₁₄FN

Molecular weight: 179.2340

Ref: IN-DA00BYNN

2-[(4-Fluorophenyl)methyl]pyrrolidine

CAS: 350017-04-8

2-[(4-Fluorophenyl)methyl]pyrrolidine

Molecular weight: 179.23396g/mol

Ref: 54-PC106950

2-(4-Fluoro-benzyl)pyrrolidine

Controlled Product

CAS: 350017-04-8

Please enquire for more information about 2-(4-Fluoro-benzyl)pyrrolidine including the price, delivery time and more detailed product information at the technical inquiry form on this page

Formula: C₁₁H₁₄FN

Purity: Min. 95%

Molecular weight: 179.23 g/mol

Ref: 3D-FF50930