CymitQuimica logo

CAS 35020-81-6

:

3-heptyl-2-[(E)-(3-heptyl-4-methyl-1,3-thiazol-2(3H)-ylidene)methyl]-4-methyl-1,3-thiazol-3-ium 2,6-dioxo-1,2,3,6-tetrahydropyrimidine-4-carboxylate

Description:
The chemical substance known as "3-heptyl-2-[(E)-(3-heptyl-4-methyl-1,3-thiazol-2(3H)-ylidene)methyl]-4-methyl-1,3-thiazol-3-ium 2,6-dioxo-1,2,3,6-tetrahydropyrimidine-4-carboxylate" with CAS number 35020-81-6 is a complex organic compound featuring multiple functional groups, including thiazole and pyrimidine derivatives. Its structure suggests it may exhibit properties typical of thiazolium salts, which can include biological activity, such as antimicrobial or antifungal effects. The presence of heptyl groups indicates a hydrophobic character, potentially influencing its solubility and interaction with biological membranes. The compound's molecular architecture suggests it may participate in various chemical reactions, including nucleophilic attacks or coordination with metal ions. Additionally, the presence of dioxo and carboxylate functionalities may contribute to its reactivity and stability under different conditions. Overall, this compound's unique structure and functional groups may make it of interest in medicinal chemistry and materials science, although specific biological or chemical properties would require empirical investigation.
Formula:C28H42N4O4S2
InChI:InChI=1/C23H39N2S2.C5H4N2O4/c1-5-7-9-11-13-15-24-20(3)18-26-22(24)17-23-25(21(4)19-27-23)16-14-12-10-8-6-2;8-3-1-2(4(9)10)6-5(11)7-3/h17-19H,5-16H2,1-4H3;1H,(H,9,10)(H2,6,7,8,11)/q+1;/p-1
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.