CymitQuimica logo

CAS 35022-44-7

:

3,4-Dichloro-α-oxobenzeneacetonitrile

Description:
3,4-Dichloro-α-oxobenzeneacetonitrile, with the CAS number 35022-44-7, is an organic compound characterized by its aromatic structure and the presence of both a nitrile and a ketone functional group. This compound features a dichlorobenzene ring, which contributes to its chemical stability and potential reactivity. The presence of the α-oxoketone moiety indicates that it can participate in various chemical reactions, such as nucleophilic additions or condensation reactions. The nitrile group (-C≡N) is known for its ability to act as a versatile functional group in organic synthesis, often serving as a precursor to amines or carboxylic acids. Additionally, the dichloro substituents can influence the compound's electronic properties, potentially affecting its reactivity and interactions with other molecules. Overall, 3,4-Dichloro-α-oxobenzeneacetonitrile is of interest in synthetic organic chemistry and may have applications in pharmaceuticals or agrochemicals, although specific applications would depend on further research and development.
Formula:C8H3Cl2NO
InChI:InChI=1S/C8H3Cl2NO/c9-6-2-1-5(3-7(6)10)8(12)4-11/h1-3H
InChI key:InChIKey=ZYAUNVXZXNJJAN-UHFFFAOYSA-N
SMILES:C(C#N)(=O)C1=CC(Cl)=C(Cl)C=C1
Synonyms:
  • 3,4-Dichloro-α-oxobenzeneacetonitrile
  • 3,4-Dichlorobenzoyl cyanide
  • 3,4-Dichlorophenylglyoxylonitrile
  • Benzeneacetonitrile, 3,4-dichloro-α-oxo-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.