CAS 35022-72-1
:6,7-Dihydrodipyrido[1,2-a:2′,1′-c]pyrazine-4,9-dione
Description:
6,7-Dihydrodipyrido[1,2-a:2′,1′-c]pyrazine-4,9-dione, with the CAS number 35022-72-1, is a heterocyclic compound characterized by its fused bicyclic structure that incorporates both pyridine and pyrazine rings. This compound features two nitrogen atoms in its structure, contributing to its basicity and potential for forming coordination complexes. It typically exhibits a range of chemical reactivity due to the presence of the diketone functional groups, which can participate in various reactions such as nucleophilic addition and condensation. The compound is often studied for its biological activity, particularly in the context of medicinal chemistry, where it may exhibit antimicrobial or antitumor properties. Its solubility and stability can vary depending on the solvent and environmental conditions, making it important to consider these factors in experimental applications. Overall, 6,7-Dihydrodipyrido[1,2-a:2′,1′-c]pyrazine-4,9-dione is of interest in both synthetic and pharmaceutical chemistry due to its unique structural features and potential biological activities.
Formula:C12H10N2O2
InChI:InChI=1S/C12H10N2O2/c15-11-5-1-3-9-10-4-2-6-12(16)14(10)8-7-13(9)11/h1-6H,7-8H2
InChI key:InChIKey=KCTKVKNCYCXHMV-UHFFFAOYSA-N
SMILES:O=C1N2C(C=3N(CC2)C(=O)C=CC3)=CC=C1
Synonyms:- Dipyrido[1,2-a:2′,1′-c]pyrazine-4,9-dione, 6,7-dihydro-
- 6,7-Dihydrodipyrido[1,2-a:2′,1′-c]pyrazine-4,9-dione
- Diquat dipyridone
- Dipyrido[1,2-a:2',1'-c]pyrazine-4,9-dione, 6,7-dihydro-
- 6,7-dihydrodipyrido[1,2-d:1',2'-f]pyrazine-4,9-dione
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Diquat Dipyridone
CAS:Applications Diquat Dipyridone is an metabolite of Diquat (D492900) a contact herbicide used also to produce desiccation and defoliation.
References Fuke, C., et al.: Legal. Med., 4, 156 (2002); Ameno, K., et al.: J. Liq. Chorma., 18, 2115 (1995); Brian, et al.: Nature, 181, 446 (1958); Gaines, T.B., et al.: Fundam. Appl. Toxicol., 7, 299 (1986),Formula:C12H10N2O2Color and Shape:NeatMolecular weight:214.22
