CAS 35038-32-5
:Chlorin e6 trimethyl ester
Description:
Chlorin e6 trimethyl ester, with the CAS number 35038-32-5, is a chlorin derivative that exhibits notable characteristics relevant to its applications in photodynamic therapy and as a photosensitizer. This compound is a modified form of chlorin e6, which is derived from natural sources such as the chlorophyll of certain algae. It features a central porphyrin-like structure with specific modifications that enhance its solubility and photophysical properties. Chlorin e6 trimethyl ester is known for its strong absorption in the near-infrared region, making it effective for targeting deeper tissues in medical applications. Additionally, it has a high singlet oxygen generation capacity upon light activation, which is crucial for its role in inducing cytotoxic effects in cancer cells. The trimethyl ester groups improve its stability and bioavailability, facilitating its use in various formulations. Overall, this compound is significant in the fields of medicinal chemistry and phototherapy due to its unique optical properties and biological activity.
Formula:C37H42N4O6
InChI:InChI=1S/C37H42N4O6/c1-10-22-18(3)26-15-28-20(5)24(12-13-32(42)45-7)35(40-28)25(14-33(43)46-8)36-34(37(44)47-9)21(6)29(41-36)17-31-23(11-2)19(4)27(39-31)16-30(22)38-26/h10,15-17,20,24,38,41H,1,11-14H2,2-9H3/b26-15?,27-16-,28-15-,29-17-,30-16?,31-17?,35-25?,36-25-/t20-,24-/m0/s1
InChI key:InChIKey=LXSAEOQFNKQCFM-MKCFQLTFSA-N
SMILES:C(C(OC)=O)C=1C2=C(C(OC)=O)C(C)=C(N2)C=C3C(CC)=C(C)C(=N3)C=C4NC(=CC5=NC1[C@@H](CCC(OC)=O)[C@@H]5C)C(C)=C4C=C
Synonyms:- Methyl (2S-trans)-13-ethyl-2,3-dihydro-18-(methoxycarbonyl)-20-(2-methoxy-2-oxoethyl)-3,7,12,17-tetramethyl-8-vinyl-21H,23H-porphine-2-propionate
- Chlorin e6 trimethyl ester
- Chlorine e6, trimethyl ester
- 21H,23H-Porphine-7-propanoic acid, 13-ethenyl-18-ethyl-7,8-dihydro-3-(methoxycarbonyl)-5-(2-methoxy-2-oxoethyl)-2,8,12,17-tetramethyl-, methyl ester, (7S,8S)-
- NSC 267064
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
Chlorin e6 trimethyl ester
CAS:Chlorin e6 trimethyl ester, a derivative of methyl pheophorbide-a, is an effective photosensitizer for photodynamic therapy (PDT).Formula:C37H42N4O6Color and Shape:SolidMolecular weight:638.765Chlorin e6 Trimethyl Ester
CAS:Controlled ProductApplications Chlorin-e6-trimethyl ester (CAS# 35038-32-5) is a useful research chemical compound.
Formula:C37H42N4O6Color and Shape:NeatMolecular weight:638.753Chlorin-e6-trimethyl ester
CAS:Chlorin-e6-trimethyl ester is a diagnostic agent that binds to the carbonyl group of proteins. It can be used for the detection of tumor tissue and for the identification of viruses such as influenza virus. Chlorin-e6-trimethyl ester has been shown to inhibit viral replication by binding to the viral envelope protein and preventing binding to host cells. This agent also inhibits bacterial growth, and has been shown to have anti-influenza virus activity in vitro. Chlorin-e6-trimethyl ester is absorbed through the cornea and is used as an ophthalmic agent. In addition, this compound has been shown to be effective against cancerous tissues in vivo.Formula:C37H42N4O6Purity:Min. 95%Molecular weight:638.75 g/mol




