CAS 35042-48-9
:5,6,7,8-tetrahydroquinazoline-2,4(1H,3H)-dione
Description:
5,6,7,8-Tetrahydroquinazoline-2,4(1H,3H)-dione, with the CAS number 35042-48-9, is a bicyclic compound that features a quinazoline core structure. This substance is characterized by its four saturated carbon atoms and two carbonyl groups, which contribute to its stability and reactivity. It typically appears as a crystalline solid and is soluble in polar organic solvents. The compound exhibits potential biological activity, making it of interest in medicinal chemistry and drug development. Its structure allows for various functional modifications, which can enhance its pharmacological properties. The presence of the dione functional groups suggests that it may participate in hydrogen bonding and other interactions, influencing its behavior in biological systems. Additionally, the compound's unique ring structure may contribute to its ability to interact with specific biological targets, making it a candidate for further research in therapeutic applications. Overall, 5,6,7,8-tetrahydroquinazoline-2,4(1H,3H)-dione is a versatile compound with significant implications in the field of chemistry and pharmacology.
Formula:C8H10N2O2
InChI:InChI=1/C8H10N2O2/c11-7-5-3-1-2-4-6(5)9-8(12)10-7/h1-4H2,(H2,9,10,11,12)
SMILES:C1CCc2c(C1)c(nc(n2)O)O
Synonyms:- 2,4(1H,3H)-quinazolinedione, 5,6,7,8-tetrahydro-
- 5,6,7,8-Tetrahydroquinazoline-2,4(1H,3H)-dione
- 5,6,7,8-Tetrahydro-1H-quinazoline-2,4-dione
- 5,6,7,8-Tetrahydro-2,4(1H,3H)-quinazolinedione
- 1,2,3,4,5,6,7,8-octahydroquinazoline-2,4-dione
- 2,4-Dihydroxy-5,6,7,8-tetrahydroquinazoline
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
5,6,7,8-Tetrahydroquinazoline-2,4-diol
CAS:Formula:C8H10N2O2Purity:97%Color and Shape:SolidMolecular weight:166.17721,2,3,4,5,6,7,8-Octahydroquinazoline-2,4-dione
CAS:<p>1,2,3,4,5,6,7,8-Octahydroquinazoline-2,4-dione</p>Purity:96%Molecular weight:166.18g/mol5,6,7,8-Tetrahydroquinazoline-2,4(1H,3H)-dione
CAS:Formula:C8H10N2O2Purity:97%Molecular weight:166.181,2,3,4,5,6,7,8-Octahydroquinazoline-2,4-dione
CAS:<p>1,2,3,4,5,6,7,8-Octahydroquinazoline-2,4-dione is a bicyclic compound that has high potency as an antagonist at the 5HT2A receptor. This compound is orally active and has been shown to be effective against ketanserin in vitro. The bicyclic ring system of 1,2,3,4,5,6,7,8-octahydroquinazoline-2,4-dione provides the molecule with a high degree of lipophilicity and this may account for its potent activity.</p>Formula:C8H10N2O2Purity:Min. 95%Molecular weight:166.18 g/mol



