
CAS 35044-68-9
:1-(2,6,6-Trimethyl-1-cyclohexen-1-yl)-2-buten-1-one
Description:
1-(2,6,6-Trimethyl-1-cyclohexen-1-yl)-2-buten-1-one, with CAS number 35044-68-9, is an organic compound characterized by its unique structure that includes a cyclohexene ring and a butenone functional group. This compound typically exhibits a complex molecular geometry due to the presence of multiple substituents on the cyclohexene ring, which can influence its reactivity and physical properties. It is likely to be a colorless to pale yellow liquid with a distinctive odor, often associated with floral or fruity notes, making it of interest in the fragrance and flavor industries. The presence of the butenone moiety suggests potential reactivity in various chemical reactions, including Michael additions and Diels-Alder reactions. Additionally, its structural features may contribute to its stability under standard conditions, although specific stability and reactivity can vary based on environmental factors. Overall, this compound represents a fascinating example of how structural complexity can lead to diverse applications in organic chemistry and related fields.
Formula:C13H20O
InChI:InChI=1S/C13H20O/c1-5-7-11(14)12-10(2)8-6-9-13(12,3)4/h5,7H,6,8-9H2,1-4H3
InChI key:InChIKey=BGTBFNDXYDYBEY-UHFFFAOYSA-N
SMILES:C(C=CC)(=O)C=1C(C)(C)CCCC1C
Synonyms:- 1-(2,6,6-Trimethylcyclohexenyl)-2-buten-1-one
- 2-Buten-1-one, 1-(2,6,6-trimethyl-1-cyclohexen-1-yl)-
- 2,6,6-Trimethyl-1-crotonoyl-1-cyclohexene
- 1-(2,6,6-Trimethyl-1-cyclohexen-1-yl)-2-buten-1-one
- 2,6,6-Trimethyl-1-(2-butenoyl)-1-cyclohexene
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
(E)-β-Damascone 1000 µg/mL in Acetonitrile
CAS:Formula:C13H20OColor and Shape:Single SolutionMolecular weight:192.301-(2,6,6-Trimethylcyclohex-1-en-1-yl)but-2-en-1-one
CAS:1-(2,6,6-Trimethylcyclohex-1-en-1-yl)but-2-en-1-one (TMBEH) is a hydroxy group that is used as an additive in tobacco and medicines. It is a precursor to the aromatic compound methyl anthranilate, which has been shown to have antiinflammatory properties. TMBEH is also used as a flavorant in food and beverages and can be found in products such as colas, ice cream, chewing gum, and candy. TMBEH can be produced by irradiation of 2,6,6-trimethylcyclohexanone with ultraviolet light or by reacting it with metal hydroxides or alkali metals in an organic solvent.Formula:C13H20OPurity:Min. 95%Molecular weight:192.3 g/mol



